Difference between revisions of "CPD-7004"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ00411 == * transcription-direction: ** positive * right-end-position: ** 565924 * left-end-position: ** 560840 * centisome-position: ** 98.76343...")
(Created page with "Category:metabolite == Metabolite MANNITOL-1P == * common-name: ** d-mannitol 1-phosphate * smiles: ** c(c(c(c(c(cop([o-])([o-])=o)o)o)o)o)o * inchi-key: ** gactwzzmvmukng...")
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ00411 ==
+
== Metabolite MANNITOL-1P ==
−
* transcription-direction:
+
* common-name:
−
** positive
+
** d-mannitol 1-phosphate
−
* right-end-position:
+
* smiles:
−
** 565924
+
** c(c(c(c(c(cop([o-])([o-])=o)o)o)o)o)o
−
* left-end-position:
+
* inchi-key:
−
** 560840
+
** gactwzzmvmukng-kvtdhhqdsa-l
−
* centisome-position:
+
* molecular-weight:
−
** 98.76343   
+
** 260.137
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[MANNITOL-1-PHOSPHATASE-RXN]]
−
== Reaction(s) associated ==
+
* [[MANNPDEHYDROG-RXN]]
−
* [[RIB5PISOM-RXN]]
+
== Reaction(s) known to produce the compound ==
−
** Category: [[annotation]]
+
* [[MANNPDEHYDROG-RXN]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
== Reaction(s) of unknown directionality ==
−
** Category: [[orthology]]
+
{{#set: common-name=d-mannitol 1-phosphate}}
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
{{#set: inchi-key=inchikey=gactwzzmvmukng-kvtdhhqdsa-l}}
−
== Pathway(s) associated ==
+
{{#set: molecular-weight=260.137}}
−
* [[P124-PWY]]
 
−
** '''12''' reactions found over '''15''' reactions in the full pathway
 
−
* [[P185-PWY]]
 
−
** '''11''' reactions found over '''12''' reactions in the full pathway
 
−
* [[NONOXIPENT-PWY]]
 
−
** '''5''' reactions found over '''5''' reactions in the full pathway
 
−
* [[PWY-5723]]
 
−
** '''10''' reactions found over '''10''' reactions in the full pathway
 
−
* [[CALVIN-PWY]]
 
−
** '''12''' reactions found over '''13''' reactions in the full pathway
 
−
* [[PWY-1861]]
 
−
** '''7''' reactions found over '''9''' reactions in the full pathway
 
−
{{#set: transcription-direction=positive}}
 
−
{{#set: right-end-position=565924}}
 
−
{{#set: left-end-position=560840}}
 
−
{{#set: centisome-position=98.76343    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=1}}
 
−
{{#set: nb pathway associated=6}}
 

Revision as of 20:30, 18 December 2020

Metabolite MANNITOL-1P

  • common-name:
    • d-mannitol 1-phosphate
  • smiles:
    • c(c(c(c(c(cop([o-])([o-])=o)o)o)o)o)o
  • inchi-key:
    • gactwzzmvmukng-kvtdhhqdsa-l
  • molecular-weight:
    • 260.137

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-7004&oldid=45741"