Difference between revisions of "CPD-7005"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-6741 == * common-name: ** d-myo-inositol (1,2,3,5,6) pentakisphosphate * smiles: ** c1(o)(c(op(=o)([o-])[o-])c(op([o-])(=o)[o-])c(op(...")
(Created page with "Category:metabolite == Metabolite CPD-7005 == * common-name: ** geranylgeranyl chlorophyll a * smiles: ** c=cc2(=c(c)c5(=cc1(c(c)c(ccc(=o)occ=c(c)ccc=c(c)ccc=c(c)ccc=c(c)c...")
 
(2 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-6741 ==
+
== Metabolite CPD-7005 ==
 
* common-name:
 
* common-name:
** d-myo-inositol (1,2,3,5,6) pentakisphosphate
+
** geranylgeranyl chlorophyll a
 
* smiles:
 
* smiles:
** c1(o)(c(op(=o)([o-])[o-])c(op([o-])(=o)[o-])c(op([o-])([o-])=o)c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])1)
+
** c=cc2(=c(c)c5(=cc1(c(c)c(ccc(=o)occ=c(c)ccc=c(c)ccc=c(c)ccc=c(c)c)c(n=1)=c7([c-](c(oc)=o)c(=o)c6(c(c)=c4(n([mg]n(c2=cc3(c(c)=c(cc)c(n=3)=c4))5)c=67))))))
 
* inchi-key:
 
* inchi-key:
** ctpqaxvnygzuaj-uotptpdrsa-d
+
** qblsepresqjtci-znlwzyposa-m
 
* molecular-weight:
 
* molecular-weight:
** 569.977
+
** 886.447
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-17428]]
 +
* [[RXN-7664]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-7241]]
+
* [[RXN-7663]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=d-myo-inositol (1,2,3,5,6) pentakisphosphate}}
+
{{#set: common-name=geranylgeranyl chlorophyll a}}
{{#set: inchi-key=inchikey=ctpqaxvnygzuaj-uotptpdrsa-d}}
+
{{#set: inchi-key=inchikey=qblsepresqjtci-znlwzyposa-m}}
{{#set: molecular-weight=569.977}}
+
{{#set: molecular-weight=886.447}}

Latest revision as of 11:14, 18 March 2021

Metabolite CPD-7005

  • common-name:
    • geranylgeranyl chlorophyll a
  • smiles:
    • c=cc2(=c(c)c5(=cc1(c(c)c(ccc(=o)occ=c(c)ccc=c(c)ccc=c(c)ccc=c(c)c)c(n=1)=c7([c-](c(oc)=o)c(=o)c6(c(c)=c4(n([mg]n(c2=cc3(c(c)=c(cc)c(n=3)=c4))5)c=67))))))
  • inchi-key:
    • qblsepresqjtci-znlwzyposa-m
  • molecular-weight:
    • 886.447

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality