Difference between revisions of "CPD-7005"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-19489 == * common-name: ** 3-isopropyl-8-(methylthio)-2-oxooctanoate * smiles: ** cscccccc(c(=o)c(=o)[o-])c(=o)[o-] * inchi-key: ** y...") |
(Created page with "Category:metabolite == Metabolite EIF5A-LYSINE == * common-name: ** an [eif5a-precursor]-lysine == Reaction(s) known to consume the compound == * 2.5.1.46-RXN * RXN-...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite EIF5A-LYSINE == |
* common-name: | * common-name: | ||
| − | ** | + | ** an [eif5a-precursor]-lysine |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[2.5.1.46-RXN]] |
| + | * [[RXN-13416]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=an [eif5a-precursor]-lysine}} |
| − | |||
| − | |||
Revision as of 15:27, 5 January 2021
Contents
Metabolite EIF5A-LYSINE
- common-name:
- an [eif5a-precursor]-lysine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "an [eif5a-precursor]-lysine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
