Difference between revisions of "CPD-7005"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite EIF5A-LYSINE == * common-name: ** an [eif5a-precursor]-lysine == Reaction(s) known to consume the compound == * 2.5.1.46-RXN * RXN-...")
(Created page with "Category:metabolite == Metabolite CPD-10267 == * common-name: ** decanoyl-coa * smiles: ** cccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-]...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite EIF5A-LYSINE ==
+
== Metabolite CPD-10267 ==
 
* common-name:
 
* common-name:
** an [eif5a-precursor]-lysine
+
** decanoyl-coa
 +
* smiles:
 +
** cccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 +
* inchi-key:
 +
** cnkjphsefdpydb-hsjnekgzsa-j
 +
* molecular-weight:
 +
** 917.754
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.5.1.46-RXN]]
+
* [[RXN-13615]]
* [[RXN-13416]]
+
* [[RXN-14274]]
 +
* [[RXN-9628]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-13614]]
 +
* [[RXN-14274]]
 +
* [[TRANS-2-ENOYL-COA-REDUCTASE-NAD+-RXN-CPD-10267/NAD//T2-DECENOYL-COA/NADH/PROTON.43.]]
 +
* [[TRANSENOYLCOARED-RXN-CPD-10267/NADP//T2-DECENOYL-COA/NADPH/PROTON.45.]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=an [eif5a-precursor]-lysine}}
+
{{#set: common-name=decanoyl-coa}}
 +
{{#set: inchi-key=inchikey=cnkjphsefdpydb-hsjnekgzsa-j}}
 +
{{#set: molecular-weight=917.754}}

Revision as of 13:10, 14 January 2021

Metabolite CPD-10267

  • common-name:
    • decanoyl-coa
  • smiles:
    • cccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • cnkjphsefdpydb-hsjnekgzsa-j
  • molecular-weight:
    • 917.754

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality