Difference between revisions of "CPD-7006"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite ARACHIDIC_ACID == * common-name: ** arachidate * smiles: ** cccccccccccccccccccc(=o)[o-] * inchi-key: ** vkobvwxkncxxde-uhfffaoysa-m * mo...")
(Created page with "Category:metabolite == Metabolite CPD-17367 == * common-name: ** (3r)-hydroxy-adrenoyl-coa * smiles: ** cccccc=ccc=ccc=ccc=ccccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite ARACHIDIC_ACID ==
+
== Metabolite CPD-17367 ==
 
* common-name:
 
* common-name:
** arachidate
+
** (3r)-hydroxy-adrenoyl-coa
 
* smiles:
 
* smiles:
** cccccccccccccccccccc(=o)[o-]
+
** cccccc=ccc=ccc=ccc=ccccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
* inchi-key:
** vkobvwxkncxxde-uhfffaoysa-m
+
** jhxlrlhtjymvbk-dhdhvehbsa-j
 
* molecular-weight:
 
* molecular-weight:
** 311.527
+
** 1094.012
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-16113]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-9629]]
+
* [[RXN-16112]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=arachidate}}
+
{{#set: common-name=(3r)-hydroxy-adrenoyl-coa}}
{{#set: inchi-key=inchikey=vkobvwxkncxxde-uhfffaoysa-m}}
+
{{#set: inchi-key=inchikey=jhxlrlhtjymvbk-dhdhvehbsa-j}}
{{#set: molecular-weight=311.527}}
+
{{#set: molecular-weight=1094.012}}

Revision as of 18:59, 14 January 2021

Metabolite CPD-17367

  • common-name:
    • (3r)-hydroxy-adrenoyl-coa
  • smiles:
    • cccccc=ccc=ccc=ccc=ccccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • jhxlrlhtjymvbk-dhdhvehbsa-j
  • molecular-weight:
    • 1094.012

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality