Difference between revisions of "CPD-7006"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17367 == * common-name: ** (3r)-hydroxy-adrenoyl-coa * smiles: ** cccccc=ccc=ccc=ccc=ccccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o...")
(Created page with "Category:metabolite == Metabolite Acetoacetyl-ACPs == * common-name: ** an acetoacetyl-[acp] == Reaction(s) known to consume the compound == * RXN-9514 == Reaction(s)...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-17367 ==
+
== Metabolite Acetoacetyl-ACPs ==
 
* common-name:
 
* common-name:
** (3r)-hydroxy-adrenoyl-coa
+
** an acetoacetyl-[acp]
* smiles:
 
** cccccc=ccc=ccc=ccc=ccccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
** jhxlrlhtjymvbk-dhdhvehbsa-j
 
* molecular-weight:
 
** 1094.012
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-16113]]
+
* [[RXN-9514]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-16112]]
+
* [[2.3.1.180-RXN]]
 +
* [[3-OXOACYL-ACP-SYNTH-BASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(3r)-hydroxy-adrenoyl-coa}}
+
{{#set: common-name=an acetoacetyl-[acp]}}
{{#set: inchi-key=inchikey=jhxlrlhtjymvbk-dhdhvehbsa-j}}
 
{{#set: molecular-weight=1094.012}}
 

Revision as of 11:19, 15 January 2021

Metabolite Acetoacetyl-ACPs

  • common-name:
    • an acetoacetyl-[acp]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "an acetoacetyl-[acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.