Difference between revisions of "CPD-7006"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-941 == * common-name: ** s-(2-methylbutanoyl)-dihydrolipoamide * smiles: ** ccc(c(sccc(ccccc(n)=o)s)=o)c * inchi-key: ** ufncwfssegpj...")
(Created page with "Category:metabolite == Metabolite CPD-7006 == * common-name: ** tetrahydrogeranylgeranyl chlorophyll a * smiles: ** c=cc2(c(c)=c4(c=c9(c(c)c(ccc(=o)occ=c(c)cccc(c)cccc(c)c...")
 
(6 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-941 ==
+
== Metabolite CPD-7006 ==
 
* common-name:
 
* common-name:
** s-(2-methylbutanoyl)-dihydrolipoamide
+
** tetrahydrogeranylgeranyl chlorophyll a
 
* smiles:
 
* smiles:
** ccc(c(sccc(ccccc(n)=o)s)=o)c
+
** c=cc2(c(c)=c4(c=c9(c(c)c(ccc(=o)occ=c(c)cccc(c)cccc(c)ccc=c(c)c)c5(=[n+]([mg--]36([n+]1(=c(c(cc)=c(c)c1=cc=2n34)c=c7(c(c)=c8(c(=o)[c-](c(oc)=o)c5=c(n67)8)))))9))))
 
* inchi-key:
 
* inchi-key:
** ufncwfssegpjnl-uhfffaoysa-n
+
** nvdidzkepdpxjj-onwagyjksa-m
 
* molecular-weight:
 
* molecular-weight:
** 291.466
+
** 890.479
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[DHRT_LPAREN_2mbcoa_RPAREN_]]
+
* [[RXN-7666]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-7665]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=s-(2-methylbutanoyl)-dihydrolipoamide}}
+
{{#set: common-name=tetrahydrogeranylgeranyl chlorophyll a}}
{{#set: inchi-key=inchikey=ufncwfssegpjnl-uhfffaoysa-n}}
+
{{#set: inchi-key=inchikey=nvdidzkepdpxjj-onwagyjksa-m}}
{{#set: molecular-weight=291.466}}
+
{{#set: molecular-weight=890.479}}

Latest revision as of 11:17, 18 March 2021

Metabolite CPD-7006

  • common-name:
    • tetrahydrogeranylgeranyl chlorophyll a
  • smiles:
    • c=cc2(c(c)=c4(c=c9(c(c)c(ccc(=o)occ=c(c)cccc(c)cccc(c)ccc=c(c)c)c5(=[n+]([mg--]36([n+]1(=c(c(cc)=c(c)c1=cc=2n34)c=c7(c(c)=c8(c(=o)[c-](c(oc)=o)c5=c(n67)8)))))9))))
  • inchi-key:
    • nvdidzkepdpxjj-onwagyjksa-m
  • molecular-weight:
    • 890.479

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality