Difference between revisions of "CPD-7006"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-941 == * common-name: ** s-(2-methylbutanoyl)-dihydrolipoamide * smiles: ** ccc(c(sccc(ccccc(n)=o)s)=o)c * inchi-key: ** ufncwfssegpj...") |
(Created page with "Category:metabolite == Metabolite CPD-7006 == * common-name: ** tetrahydrogeranylgeranyl chlorophyll a * smiles: ** c=cc2(c(c)=c4(c=c9(c(c)c(ccc(=o)occ=c(c)cccc(c)cccc(c)c...") |
||
(6 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite CPD- | + | == Metabolite CPD-7006 == |
* common-name: | * common-name: | ||
− | ** | + | ** tetrahydrogeranylgeranyl chlorophyll a |
* smiles: | * smiles: | ||
− | ** ccc(c( | + | ** c=cc2(c(c)=c4(c=c9(c(c)c(ccc(=o)occ=c(c)cccc(c)cccc(c)ccc=c(c)c)c5(=[n+]([mg--]36([n+]1(=c(c(cc)=c(c)c1=cc=2n34)c=c7(c(c)=c8(c(=o)[c-](c(oc)=o)c5=c(n67)8)))))9)))) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** nvdidzkepdpxjj-onwagyjksa-m |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 890.479 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-7666]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-7665]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=tetrahydrogeranylgeranyl chlorophyll a}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=nvdidzkepdpxjj-onwagyjksa-m}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=890.479}} |
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite CPD-7006
- common-name:
- tetrahydrogeranylgeranyl chlorophyll a
- smiles:
- c=cc2(c(c)=c4(c=c9(c(c)c(ccc(=o)occ=c(c)cccc(c)cccc(c)ccc=c(c)c)c5(=[n+]([mg--]36([n+]1(=c(c(cc)=c(c)c1=cc=2n34)c=c7(c(c)=c8(c(=o)[c-](c(oc)=o)c5=c(n67)8)))))9))))
- inchi-key:
- nvdidzkepdpxjj-onwagyjksa-m
- molecular-weight:
- 890.479