|
|
| Line 1: |
Line 1: |
| − | [[Category:reaction]] | + | [[Category:metabolite]] |
| − | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ACONITATEHYDR-RXN ACONITATEHYDR-RXN] == | + | == Metabolite CPD-941 == |
| − | * direction:
| |
| − | ** reversible
| |
| | * common-name: | | * common-name: |
| − | ** cis-aconitate hydratase | + | ** s-(2-methylbutanoyl)-dihydrolipoamide |
| − | ** d-threo-isocitrate hydro-lyase (cis-aconitate-forming)
| + | * smiles: |
| − | == Reaction formula ==
| + | ** ccc(c(sccc(ccccc(n)=o)s)=o)c |
| − | * 1 [[CIS-ACONITATE]][c] '''+''' 1 [[WATER]][c] '''<=>''' 1 [[THREO-DS-ISO-CITRATE]][c]
| + | * inchi-key: |
| − | == Gene(s) associated with this reaction ==
| + | ** ufncwfssegpjnl-uhfffaoysa-n |
| − | * Gene: [[SJ18471]] | + | * molecular-weight: |
| − | ** Category: [[annotation]] | + | ** 291.466 |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| + | == Reaction(s) known to consume the compound == |
| − | ** Category: [[orthology]]
| + | * [[DHRT_LPAREN_2mbcoa_RPAREN_]] |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| + | == Reaction(s) known to produce the compound == |
| − | * Gene: [[SJ22396]]
| + | == Reaction(s) of unknown directionality == |
| − | ** Category: [[orthology]]
| + | {{#set: common-name=s-(2-methylbutanoyl)-dihydrolipoamide}} |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| + | {{#set: inchi-key=inchikey=ufncwfssegpjnl-uhfffaoysa-n}} |
| − | == Pathway(s) == | + | {{#set: molecular-weight=291.466}} |
| − | <div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
| |
| − | * [[PWY-6549]], L-glutamine biosynthesis III: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6549 PWY-6549] | |
| − | ** '''8''' reactions found over '''9''' reactions in the full pathway | |
| − | * [[PWY-5392]], reductive TCA cycle II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5392 PWY-5392]
| |
| − | ** '''6''' reactions found over '''12''' reactions in the full pathway
| |
| − | * [[PWY-5690]], TCA cycle II (plants and fungi): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5690 PWY-5690] | |
| − | ** '''8''' reactions found over '''9''' reactions in the full pathway | |
| − | * [[P105-PWY]], TCA cycle IV (2-oxoglutarate decarboxylase): [http://metacyc.org/META/NEW-IMAGE?object=P105-PWY P105-PWY]
| |
| − | ** '''10''' reactions found over '''11''' reactions in the full pathway
| |
| − | * [[TCA]], TCA cycle I (prokaryotic): [http://metacyc.org/META/NEW-IMAGE?object=TCA TCA]
| |
| − | ** '''9''' reactions found over '''10''' reactions in the full pathway
| |
| − | * [[REDCITCYC]], TCA cycle VIII (Helicobacter): [http://metacyc.org/META/NEW-IMAGE?object=REDCITCYC REDCITCYC]
| |
| − | ** '''5''' reactions found over '''9''' reactions in the full pathway
| |
| − | * [[PWY66-398]], TCA cycle III (animals): [http://metacyc.org/META/NEW-IMAGE?object=PWY66-398 PWY66-398]
| |
| − | ** '''10''' reactions found over '''11''' reactions in the full pathway
| |
| − | * [[PWY-7254]], TCA cycle VII (acetate-producers): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7254 PWY-7254]
| |
| − | ** '''7''' reactions found over '''9''' reactions in the full pathway
| |
| − | * [[PWY-6969]], TCA cycle V (2-oxoglutarate:ferredoxin oxidoreductase): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6969 PWY-6969]
| |
| − | ** '''10''' reactions found over '''12''' reactions in the full pathway
| |
| − | * [[PWY-5913]], partial TCA cycle (obligate autotrophs): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5913 PWY-5913] | |
| − | ** '''10''' reactions found over '''11''' reactions in the full pathway
| |
| − | * [[FERMENTATION-PWY]], mixed acid fermentation: [http://metacyc.org/META/NEW-IMAGE?object=FERMENTATION-PWY FERMENTATION-PWY]
| |
| − | ** '''11''' reactions found over '''16''' reactions in the full pathway
| |
| − | * [[P23-PWY]], reductive TCA cycle I: [http://metacyc.org/META/NEW-IMAGE?object=P23-PWY P23-PWY]
| |
| − | ** '''9''' reactions found over '''12''' reactions in the full pathway
| |
| − | * [[PWY-7124]], ethylene biosynthesis V (engineered): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7124 PWY-7124]
| |
| − | ** '''8''' reactions found over '''8''' reactions in the full pathway
| |
| − | * [[PWY-6728]], methylaspartate cycle: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6728 PWY-6728]
| |
| − | ** '''11''' reactions found over '''19''' reactions in the full pathway
| |
| − | * [[GLYOXYLATE-BYPASS]], glyoxylate cycle: [http://metacyc.org/META/NEW-IMAGE?object=GLYOXYLATE-BYPASS GLYOXYLATE-BYPASS]
| |
| − | ** '''6''' reactions found over '''6''' reactions in the full pathway
| |
| − | </div>
| |
| − | == Reconstruction information ==
| |
| − | * category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | * category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
| |
| − | == External links == | |
| − | * RHEA:
| |
| − | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=22147 22147]
| |
| − | * LIGAND-RXN:
| |
| − | ** [http://www.genome.jp/dbget-bin/www_bget?R01900 R01900]
| |
| − | {{#set: direction=reversible}}
| |
| − | {{#set: common-name=cis-aconitate hydratase|d-threo-isocitrate hydro-lyase (cis-aconitate-forming)}} | |
| − | {{#set: nb gene associated=2}} | |
| − | {{#set: nb pathway associated=15}}
| |
| − | {{#set: reconstruction category=annotation|orthology}}
| |
| − | {{#set: reconstruction tool=pantograph|pathwaytools}} | |
| − | {{#set: reconstruction comment=n.a}}
| |
| − | {{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus|saccharina_japonica_genome}}
| |
