Difference between revisions of "CPD-7013"

Revision as of 15:29, 5 January 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite CPD-15425 ==
+== Metabolite FE+3 ==
 * common-name:
-** 6''-o-carbamoylkanamycin a
+** fe3+
 * smiles:
-** c([n+])c1(c(o)c(o)c(o)c(o1)oc2(c([n+])cc(c(c2o)oc3(oc(coc(=o)n)c(o)c([n+])c(o)3))[n+]))
+** [fe+++]
 * inchi-key:
-** prwqrpnqdikfbr-noamyhissa-r
+** vtlyfuhaoxggbs-uhfffaoysa-n
 * molecular-weight:
-** 531.559
+** 55.847
 == Reaction(s) known to consume the compound ==
+* [[3.6.3.30-RXN]]
+* [[ExchangeSeed-FE+3]]
+* [[FE3abch]]
+* [[FESO3OXI-RXN]]
+* [[IRON--CYTOCHROME-C-REDUCTASE-RXN]]
+* [[RXN-14387]]
+* [[RXN-15598]]
+* [[TransportSeed-FE+3]]
 == Reaction(s) known to produce the compound ==
-* [[RXN-13167]]
+* [[3.6.3.30-RXN]]
-* [[RXN-15285]]
+* [[ExchangeSeed-FE+3]]
+* [[FE3abch]]
+* [[FESO3OXI-RXN]]
+* [[IRON--CYTOCHROME-C-REDUCTASE-RXN]]
+* [[RXN0-1483]]
+* [[TransportSeed-FE+3]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=6''-o-carbamoylkanamycin a}}
+{{#set: common-name=fe3+}}
-{{#set: inchi-key=inchikey=prwqrpnqdikfbr-noamyhissa-r}}
+{{#set: inchi-key=inchikey=vtlyfuhaoxggbs-uhfffaoysa-n}}
-{{#set: molecular-weight=531.559}}
+{{#set: molecular-weight=55.847}}