Difference between revisions of "CPD-7015"

Revision as of 11:18, 15 January 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite CPD-17386 ==
+== Metabolite Reduced-NrdH-Proteins ==
 * common-name:
-** (2e,6z,9z,12z,15z,18z,21z)-tetracosaheptaenoyl-coa
+** a reduced nrdh glutaredoxin-like protein
-* smiles:
-** ccc=ccc=ccc=ccc=ccc=ccc=cccc=cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
-* inchi-key:
-** nvowzibkqiwtdg-aducosnasa-j
-* molecular-weight:
-** 1100.019
 == Reaction(s) known to consume the compound ==
-* [[RXN-16135]]
+* [[RIBONUCLEOSIDE-DIP-REDUCTII-RXN]]
+* [[RXN0-722]]
+* [[RXN0-747]]
+* [[RXN0-748]]
 == Reaction(s) known to produce the compound ==
-* [[RXN-16134]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=(2e,6z,9z,12z,15z,18z,21z)-tetracosaheptaenoyl-coa}}
+{{#set: common-name=a reduced nrdh glutaredoxin-like protein}}
-{{#set: inchi-key=inchikey=nvowzibkqiwtdg-aducosnasa-j}}
-{{#set: molecular-weight=1100.019}}