Difference between revisions of "CPD-7015"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite ALPHA-GLUCOSE-16-BISPHOSPHATE == * common-name: ** α-glucose 1,6-bisphosphate * smiles: ** c(op([o-])(=o)[o-])c1(oc(c(c(c1o)o)o)op(...")
(Created page with "Category:metabolite == Metabolite Leader-Sequences == * common-name: ** a leader sequence == Reaction(s) known to consume the compound == == Reaction(s) known to produce t...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite ALPHA-GLUCOSE-16-BISPHOSPHATE ==
+
== Metabolite Leader-Sequences ==
 
* common-name:
 
* common-name:
** α-glucose 1,6-bisphosphate
+
** a leader sequence
* smiles:
 
** c(op([o-])(=o)[o-])c1(oc(c(c(c1o)o)o)op(=o)([o-])[o-])
 
* inchi-key:
 
** rwhozgraxywrnx-vfuothlcsa-j
 
* molecular-weight:
 
** 336.085
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-16998]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-16997]]
+
* [[3.4.21.89-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=α-glucose 1,6-bisphosphate}}
+
{{#set: common-name=a leader sequence}}
{{#set: inchi-key=inchikey=rwhozgraxywrnx-vfuothlcsa-j}}
 
{{#set: molecular-weight=336.085}}
 

Revision as of 14:58, 5 January 2021

Metabolite Leader-Sequences

  • common-name:
    • a leader sequence

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality