Difference between revisions of "CPD-7025"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite RIBOSE-5P == * common-name: ** d-ribose 5-phosphate == Reaction(s) known to consume the compound == * 1TRANSKETO-RXN * PPENTOMUT-RX...") |
(Created page with "Category:metabolite == Metabolite CPD-7025 == * common-name: ** phytyl monophosphate * smiles: ** cc(cccc(cccc(c)cccc(c)=ccop([o-])(=o)[o-])c)c * inchi-key: ** yrxrhzokdfc...") |
||
| (One intermediate revision by one other user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-7025 == |
* common-name: | * common-name: | ||
| − | ** | + | ** phytyl monophosphate |
| + | * smiles: | ||
| + | ** cc(cccc(cccc(c)cccc(c)=ccop([o-])(=o)[o-])c)c | ||
| + | * inchi-key: | ||
| + | ** yrxrhzokdfcxib-pyddkjgssa-l | ||
| + | * molecular-weight: | ||
| + | ** 374.499 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-7683]] |
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=phytyl monophosphate}} |
| + | {{#set: inchi-key=inchikey=yrxrhzokdfcxib-pyddkjgssa-l}} | ||
| + | {{#set: molecular-weight=374.499}} | ||
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite CPD-7025
- common-name:
- phytyl monophosphate
- smiles:
- cc(cccc(cccc(c)cccc(c)=ccop([o-])(=o)[o-])c)c
- inchi-key:
- yrxrhzokdfcxib-pyddkjgssa-l
- molecular-weight:
- 374.499
