Difference between revisions of "CPD-7025"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ03483 == * transcription-direction: ** positive * right-end-position: ** 7773 * left-end-position: ** 95 * centisome-position: ** 7.89397100e-2 ==...")
(Created page with "Category:metabolite == Metabolite CPD-7025 == * common-name: ** phytyl monophosphate * smiles: ** cc(cccc(cccc(c)cccc(c)=ccop([o-])(=o)[o-])c)c * inchi-key: ** yrxrhzokdfc...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ03483 ==
+
== Metabolite CPD-7025 ==
−
* transcription-direction:
+
* common-name:
−
** positive
+
** phytyl monophosphate
−
* right-end-position:
+
* smiles:
−
** 7773
+
** cc(cccc(cccc(c)cccc(c)=ccop([o-])(=o)[o-])c)c
−
* left-end-position:
+
* inchi-key:
−
** 95
+
** yrxrhzokdfcxib-pyddkjgssa-l
−
* centisome-position:
+
* molecular-weight:
−
** 7.89397100e-2
+
** 374.499
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
== Reaction(s) known to produce the compound ==
−
== Reaction(s) associated ==
+
* [[RXN-7683]]
−
* [[3.1.3.46-RXN]]
+
== Reaction(s) of unknown directionality ==
−
** Category: [[annotation]]
+
{{#set: common-name=phytyl monophosphate}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=yrxrhzokdfcxib-pyddkjgssa-l}}
−
* [[4-NITROPHENYLPHOSPHATASE-RXN]]
+
{{#set: molecular-weight=374.499}}
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[6-PHOSPHOFRUCTO-2-KINASE-RXN]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* [[SUGAR-PHOSPHATASE-RXN]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== Pathway(s) associated ==
 
−
* [[PWY66-423]]
 
−
** '''2''' reactions found over '''2''' reactions in the full pathway
 
−
{{#set: transcription-direction=positive}}
 
−
{{#set: right-end-position=7773}}
 
−
{{#set: left-end-position=95}}
 
−
{{#set: centisome-position=7.89397100e-2}}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=4}}
 
−
{{#set: nb pathway associated=1}}
 

Latest revision as of 11:14, 18 March 2021

Metabolite CPD-7025

  • common-name:
    • phytyl monophosphate
  • smiles:
    • cc(cccc(cccc(c)cccc(c)=ccop([o-])(=o)[o-])c)c
  • inchi-key:
    • yrxrhzokdfcxib-pyddkjgssa-l
  • molecular-weight:
    • 374.499

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-7025&oldid=137947"