Difference between revisions of "CPD-7025"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 5-Phospho-terminated-DNAs == * common-name: ** a 5'-phospho-[dna] == Reaction(s) known to consume the compound == * [[DNA-LIGASE-ATP-RXN]...")
(Created page with "Category:metabolite == Metabolite CPD-7025 == * common-name: ** phytyl monophosphate * smiles: ** cc(cccc(cccc(c)cccc(c)=ccop([o-])(=o)[o-])c)c * inchi-key: ** yrxrhzokdfc...")
 
(6 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 5-Phospho-terminated-DNAs ==
+
== Metabolite CPD-7025 ==
 
* common-name:
 
* common-name:
** a 5'-phospho-[dna]
+
** phytyl monophosphate
 +
* smiles:
 +
** cc(cccc(cccc(c)cccc(c)=ccop([o-])(=o)[o-])c)c
 +
* inchi-key:
 +
** yrxrhzokdfcxib-pyddkjgssa-l
 +
* molecular-weight:
 +
** 374.499
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[DNA-LIGASE-ATP-RXN]]
 
* [[DNA-LIGASE-NAD+-RXN]]
 
* [[RXN-15712]]
 
* [[RXN-15713]]
 
* [[RXN-17918]]
 
* [[RXN-17922]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[4.2.99.18-RXN]]
+
* [[RXN-7683]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a 5'-phospho-[dna]}}
+
{{#set: common-name=phytyl monophosphate}}
 +
{{#set: inchi-key=inchikey=yrxrhzokdfcxib-pyddkjgssa-l}}
 +
{{#set: molecular-weight=374.499}}

Latest revision as of 11:14, 18 March 2021

Metabolite CPD-7025

  • common-name:
    • phytyl monophosphate
  • smiles:
    • cc(cccc(cccc(c)cccc(c)=ccop([o-])(=o)[o-])c)c
  • inchi-key:
    • yrxrhzokdfcxib-pyddkjgssa-l
  • molecular-weight:
    • 374.499

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality