Difference between revisions of "CPD-7025"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPDQT-36 == * common-name: ** 3-[(3'-methylthio)propyl]malate * smiles: ** c(c(cccsc)c(o)c(=o)[o-])(=o)[o-] * inchi-key: ** sqxviiopmysnc...") |
(Created page with "Category:metabolite == Metabolite 3-UREIDO-ISOBUTYRATE == * common-name: ** 3-(carbamoylamino)-2-methylpropanoate * smiles: ** cc(cnc(n)=o)c(=o)[o-] * inchi-key: ** phentz...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite 3-UREIDO-ISOBUTYRATE == |
* common-name: | * common-name: | ||
− | ** 3- | + | ** 3-(carbamoylamino)-2-methylpropanoate |
* smiles: | * smiles: | ||
− | ** | + | ** cc(cnc(n)=o)c(=o)[o-] |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** phentznalbmcqd-gsvougtgsa-m |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 145.138 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-11210]] |
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name=3- | + | {{#set: common-name=3-(carbamoylamino)-2-methylpropanoate}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=phentznalbmcqd-gsvougtgsa-m}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=145.138}} |
Revision as of 13:09, 14 January 2021
Contents
Metabolite 3-UREIDO-ISOBUTYRATE
- common-name:
- 3-(carbamoylamino)-2-methylpropanoate
- smiles:
- cc(cnc(n)=o)c(=o)[o-]
- inchi-key:
- phentznalbmcqd-gsvougtgsa-m
- molecular-weight:
- 145.138