Difference between revisions of "CPD-7031"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 3-7-DIMETHYLXANTHINE == * common-name: ** theobromine * smiles: ** cn2(c=nc1(=c(c(nc(n(c)1)=o)=o)2)) * inchi-key: ** yapqbxqyljrxsa-uhfff...") |
(Created page with "Category:metabolite == Metabolite CPD-7031 == * common-name: ** 3-methylbutanal * smiles: ** cc(c)c[ch]=o * inchi-key: ** yghrjjrrzdovpd-uhfffaoysa-n * molecular-weight: *...") |
||
| (4 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-7031 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 3-methylbutanal |
* smiles: | * smiles: | ||
| − | ** | + | ** cc(c)c[ch]=o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** yghrjjrrzdovpd-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 86.133 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-7693]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-7693]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=3-methylbutanal}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=yghrjjrrzdovpd-uhfffaoysa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=86.133}} |
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite CPD-7031
- common-name:
- 3-methylbutanal
- smiles:
- cc(c)c[ch]=o
- inchi-key:
- yghrjjrrzdovpd-uhfffaoysa-n
- molecular-weight:
- 86.133
