Difference between revisions of "CPD-7031"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite NICOTINATE_NUCLEOTIDE == * common-name: ** β-nicotinate d-ribonucleotide * smiles: ** c(op([o-])(=o)[o-])c1(c(o)c(o)c(o1)[n+]2(c=cc=...") |
(Created page with "Category:metabolite == Metabolite 3-7-DIMETHYLXANTHINE == * common-name: ** theobromine * smiles: ** cn2(c=nc1(=c(c(nc(n(c)1)=o)=o)2)) * inchi-key: ** yapqbxqyljrxsa-uhfff...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 3-7-DIMETHYLXANTHINE == |
* common-name: | * common-name: | ||
| − | ** | + | ** theobromine |
* smiles: | * smiles: | ||
| − | ** c | + | ** cn2(c=nc1(=c(c(nc(n(c)1)=o)=o)2)) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** yapqbxqyljrxsa-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 180.166 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | + | * [[RXN-11519]] | |
| − | * [[RXN- | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=theobromine}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=yapqbxqyljrxsa-uhfffaoysa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=180.166}} |
Revision as of 15:25, 5 January 2021
Contents
Metabolite 3-7-DIMETHYLXANTHINE
- common-name:
- theobromine
- smiles:
- cn2(c=nc1(=c(c(nc(n(c)1)=o)=o)2))
- inchi-key:
- yapqbxqyljrxsa-uhfffaoysa-n
- molecular-weight:
- 180.166
