Difference between revisions of "CPD-7032"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15678 == * common-name: ** 4-trans-3-oxo-undecenoyl-coa * smiles: ** ccccccc=cc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(o...")
(Created page with "Category:metabolite == Metabolite CPD-7032 == * common-name: ** 3-methylbutanol * smiles: ** cc(cco)c * inchi-key: ** phtqwckdnzkarw-uhfffaoysa-n * molecular-weight: ** 88...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-15678 ==
+
== Metabolite CPD-7032 ==
 
* common-name:
 
* common-name:
** 4-trans-3-oxo-undecenoyl-coa
+
** 3-methylbutanol
 
* smiles:
 
* smiles:
** ccccccc=cc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** cc(cco)c
 
* inchi-key:
 
* inchi-key:
** xbfqfvlnmjddng-dupkwvsksa-j
+
** phtqwckdnzkarw-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 943.749
+
** 88.149
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14793]]
+
* [[RXN-7693]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-7693]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=4-trans-3-oxo-undecenoyl-coa}}
+
{{#set: common-name=3-methylbutanol}}
{{#set: inchi-key=inchikey=xbfqfvlnmjddng-dupkwvsksa-j}}
+
{{#set: inchi-key=inchikey=phtqwckdnzkarw-uhfffaoysa-n}}
{{#set: molecular-weight=943.749}}
+
{{#set: molecular-weight=88.149}}

Latest revision as of 11:15, 18 March 2021

Metabolite CPD-7032

  • common-name:
    • 3-methylbutanol
  • smiles:
    • cc(cco)c
  • inchi-key:
    • phtqwckdnzkarw-uhfffaoysa-n
  • molecular-weight:
    • 88.149

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality