Difference between revisions of "CPD-7033"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-13575 == * common-name: ** 2-[(2r,5z)-2-carboxy-4-methylthiazol-5(2h)-ylidene]ethyl phosphate * smiles: ** cc1(c(=ccop([o-])(=o)[o-])...")
(Created page with "Category:metabolite == Metabolite CPD-15657 == * common-name: ** (3r)-hydroxy-undecanoyl-coa * smiles: ** ccccccccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-13575 ==
+
== Metabolite CPD-15657 ==
 
* common-name:
 
* common-name:
** 2-[(2r,5z)-2-carboxy-4-methylthiazol-5(2h)-ylidene]ethyl phosphate
+
** (3r)-hydroxy-undecanoyl-coa
 
* smiles:
 
* smiles:
** cc1(c(=ccop([o-])(=o)[o-])sc(c(=o)[o-])n=1)
+
** ccccccccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
* inchi-key:
** pqmcqnovnfnpfj-hyimlasbsa-k
+
** jiogxinzsoqege-mawalykisa-j
 
* molecular-weight:
 
* molecular-weight:
** 264.169
+
** 947.78
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-12611]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[THIAZOLSYN2-RXN]]
+
* [[RXN-14778]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2-[(2r,5z)-2-carboxy-4-methylthiazol-5(2h)-ylidene]ethyl phosphate}}
+
{{#set: common-name=(3r)-hydroxy-undecanoyl-coa}}
{{#set: inchi-key=inchikey=pqmcqnovnfnpfj-hyimlasbsa-k}}
+
{{#set: inchi-key=inchikey=jiogxinzsoqege-mawalykisa-j}}
{{#set: molecular-weight=264.169}}
+
{{#set: molecular-weight=947.78}}

Revision as of 14:55, 5 January 2021

Metabolite CPD-15657

  • common-name:
    • (3r)-hydroxy-undecanoyl-coa
  • smiles:
    • ccccccccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • jiogxinzsoqege-mawalykisa-j
  • molecular-weight:
    • 947.78

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality