Difference between revisions of "CPD-7035"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD0-2231 == * common-name: ** didp * smiles: ** c(op(=o)([o-])op(=o)([o-])[o-])c1(oc(cc(o)1)n3(c=nc2(c(=o)nc=nc=23))) * inchi-key: ** bk...") |
(Created page with "Category:metabolite == Metabolite CPD-7035 == * common-name: ** 2-phenylethanol * smiles: ** c1(c=cc(cco)=cc=1) * inchi-key: ** wrmnzczemhiocp-uhfffaoysa-n * molecular-wei...") |
||
| (6 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-7035 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 2-phenylethanol |
* smiles: | * smiles: | ||
| − | ** | + | ** c1(c=cc(cco)=cc=1) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** wrmnzczemhiocp-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 122.166 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-7700]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=2-phenylethanol}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=wrmnzczemhiocp-uhfffaoysa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=122.166}} |
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite CPD-7035
- common-name:
- 2-phenylethanol
- smiles:
- c1(c=cc(cco)=cc=1)
- inchi-key:
- wrmnzczemhiocp-uhfffaoysa-n
- molecular-weight:
- 122.166
