Difference between revisions of "CPD-7035"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite ADENOSINE == * common-name: ** adenosine * smiles: ** c(o)c1(oc(c(o)c(o)1)n3(c=nc2(c(n)=nc=nc=23))) * inchi-key: ** oirdtqyftabqoq-kqynxx...")
(Created page with "Category:metabolite == Metabolite tRNA-Dihydrouridines == * common-name: ** a 5,6-dihydrouridine in trna == Reaction(s) known to consume the compound == == Reaction(s) kno...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite ADENOSINE ==
+
== Metabolite tRNA-Dihydrouridines ==
 
* common-name:
 
* common-name:
** adenosine
+
** a 5,6-dihydrouridine in trna
* smiles:
 
** c(o)c1(oc(c(o)c(o)1)n3(c=nc2(c(n)=nc=nc=23)))
 
* inchi-key:
 
** oirdtqyftabqoq-kqynxxcusa-n
 
* molecular-weight:
 
** 267.244
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ADENODEAMIN-RXN]]
 
* [[ADENOSINE-KINASE-RXN]]
 
* [[ADENOSYLHOMOCYSTEINASE-RXN]]
 
* [[ADENPHOSPHOR-RXN]]
 
* [[ADNK]]
 
* [[ADNKm]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ADENOSYLHOMOCYSTEINASE-RXN]]
+
* [[RXN0-1281]]
* [[ADENPHOSPHOR-RXN]]
 
* [[AMP-DEPHOSPHORYLATION-RXN]]
 
* [[AMP5N]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=adenosine}}
+
{{#set: common-name=a 5,6-dihydrouridine in trna}}
{{#set: inchi-key=inchikey=oirdtqyftabqoq-kqynxxcusa-n}}
 
{{#set: molecular-weight=267.244}}
 

Revision as of 13:07, 14 January 2021

Metabolite tRNA-Dihydrouridines

  • common-name:
    • a 5,6-dihydrouridine in trna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality