Difference between revisions of "CPD-7036"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite LEUCOPELARGONIDIN-CMPD == * common-name: ** (2r,3s,4s)-leucopelargonidin * smiles: ** c3(c(c2(oc1(=cc(=cc(=c1c(c2o)o)o)o)))=cc=c(c=3)o) *...") |
(Created page with "Category:metabolite == Metabolite CPD-7036 == * common-name: ** 3-methylthiopropanal * smiles: ** csccc=o * inchi-key: ** cluwowrthnnbbu-uhfffaoysa-n * molecular-weight: *...") |
||
(4 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-7036 == |
* common-name: | * common-name: | ||
− | ** | + | ** 3-methylthiopropanal |
* smiles: | * smiles: | ||
− | ** | + | ** csccc=o |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** cluwowrthnnbbu-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 104.167 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-7706]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=3-methylthiopropanal}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=cluwowrthnnbbu-uhfffaoysa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=104.167}} |
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite CPD-7036
- common-name:
- 3-methylthiopropanal
- smiles:
- csccc=o
- inchi-key:
- cluwowrthnnbbu-uhfffaoysa-n
- molecular-weight:
- 104.167