Difference between revisions of "CPD-7036"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite DEOXYURIDINE == * common-name: ** 2'-deoxyuridine * smiles: ** c1(=cn(c(=o)nc(=o)1)c2(cc(o)c(co)o2)) * inchi-key: ** mxhrcpnrjammim-shyze...") |
(Created page with "Category:metabolite == Metabolite D-ALANINE == * common-name: ** d-alanine * smiles: ** cc([n+])c([o-])=o * inchi-key: ** qnaybmklocpygj-uwtatzphsa-n * molecular-weight: *...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite D-ALANINE == |
* common-name: | * common-name: | ||
| − | ** | + | ** d-alanine |
* smiles: | * smiles: | ||
| − | ** | + | ** cc([n+])c([o-])=o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** qnaybmklocpygj-uwtatzphsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 89.094 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[D-ALANINE-AMINOTRANSFERASE-RXN]] |
| + | * [[DALADALALIG-RXN]] | ||
| + | * [[RXN-8672]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[D-ALANINE-AMINOTRANSFERASE-RXN]] |
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=d-alanine}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=qnaybmklocpygj-uwtatzphsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=89.094}} |
Revision as of 14:57, 5 January 2021
Contents
Metabolite D-ALANINE
- common-name:
- d-alanine
- smiles:
- cc([n+])c([o-])=o
- inchi-key:
- qnaybmklocpygj-uwtatzphsa-n
- molecular-weight:
- 89.094
