Difference between revisions of "CPD-7036"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17262 == * common-name: ** 3-oxo-icosatetraenoyl-coa * smiles: ** ccc=ccc=ccc=ccc=cccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)...")
(Created page with "Category:metabolite == Metabolite Sterols == * common-name: ** a sterol == Reaction(s) known to consume the compound == * STEROL-GLUCOSYLTRANSFERASE-RXN == Reaction(s)...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-17262 ==
+
== Metabolite Sterols ==
 
* common-name:
 
* common-name:
** 3-oxo-icosatetraenoyl-coa
+
** a sterol
* smiles:
 
** ccc=ccc=ccc=ccc=cccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
** vvlbcjhqulsxjn-qwoxclfssa-j
 
* molecular-weight:
 
** 1063.942
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-16020]]
+
* [[STEROL-GLUCOSYLTRANSFERASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[STEROL-ESTERASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-oxo-icosatetraenoyl-coa}}
+
{{#set: common-name=a sterol}}
{{#set: inchi-key=inchikey=vvlbcjhqulsxjn-qwoxclfssa-j}}
 
{{#set: molecular-weight=1063.942}}
 

Revision as of 18:56, 14 January 2021

Metabolite Sterols

  • common-name:
    • a sterol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality