Difference between revisions of "CPD-7037"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CYS-GLY == * common-name: ** l-cysteinyl-glycine * smiles: ** c(c([o-])=o)nc(c(cs)[n+])=o * inchi-key: ** zukpvrwzdmrieo-vkhmyheasa-n * m...") |
(Created page with "Category:metabolite == Metabolite CPD-7037 == * common-name: ** methionol * smiles: ** csccco * inchi-key: ** czugfkjycpyhhv-uhfffaoysa-n * molecular-weight: ** 106.182 ==...") |
||
| (2 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-7037 == |
* common-name: | * common-name: | ||
| − | ** | + | ** methionol |
* smiles: | * smiles: | ||
| − | ** | + | ** csccco |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** czugfkjycpyhhv-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 106.182 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-7706]] |
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=methionol}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=czugfkjycpyhhv-uhfffaoysa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=106.182}} |
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite CPD-7037
- common-name:
- methionol
- smiles:
- csccco
- inchi-key:
- czugfkjycpyhhv-uhfffaoysa-n
- molecular-weight:
- 106.182
