Difference between revisions of "CPD-706"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite holo-Transcarboxylases == * common-name: ** a holo-[methylmalonyl-coa:pyruvate carboxytransferase] == Reaction(s) known to consume the co...") |
(Created page with "Category:metabolite == Metabolite SINAPOYL-COA == * common-name: ** sinapoyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c=cc1(c=c(oc)c(o)=c(oc)c=1))cop(=o)(op(=o)(oc...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite SINAPOYL-COA == |
* common-name: | * common-name: | ||
| − | ** | + | ** sinapoyl-coa |
| + | * smiles: | ||
| + | ** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c=cc1(c=c(oc)c(o)=c(oc)c=1))cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-] | ||
| + | * inchi-key: | ||
| + | ** rbfuwesmwrugfy-gsnioflcsa-j | ||
| + | * molecular-weight: | ||
| + | ** 969.7 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-1124]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-10919]] |
| + | * [[RXN-1124]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=sinapoyl-coa}} |
| + | {{#set: inchi-key=inchikey=rbfuwesmwrugfy-gsnioflcsa-j}} | ||
| + | {{#set: molecular-weight=969.7}} | ||
Revision as of 13:08, 14 January 2021
Contents
Metabolite SINAPOYL-COA
- common-name:
- sinapoyl-coa
- smiles:
- cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c=cc1(c=c(oc)c(o)=c(oc)c=1))cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]
- inchi-key:
- rbfuwesmwrugfy-gsnioflcsa-j
- molecular-weight:
- 969.7
