Difference between revisions of "CPD-7063"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ06722 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * DNA-DIRECTED-DNA-POLYMER...") |
(Created page with "Category:metabolite == Metabolite CPD-7063 == * common-name: ** red chlorophyll catabolite * smiles: ** ccc1(c(c)=c(nc=1c=c4(c(c)=c5(c(=o)[c-](c(oc)=o)c(c2(c(ccc(=o)[o-])c...") |
||
(8 intermediate revisions by 4 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-7063 == |
− | == | + | * common-name: |
− | + | ** red chlorophyll catabolite | |
− | == | + | * smiles: |
− | * | + | ** ccc1(c(c)=c(nc=1c=c4(c(c)=c5(c(=o)[c-](c(oc)=o)c(c2(c(ccc(=o)[o-])c(c)c(n=2)=cc3(c(c)=c(c=c)c(=o)n3)))=c(n4)5)))c=o) |
− | * | + | * inchi-key: |
− | *** | + | ** gvtpycxgtfqzdt-yssugppcsa-m |
− | {{#set: | + | * molecular-weight: |
− | {{#set: | + | ** 624.692 |
+ | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-7741]] | ||
+ | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-7740]] | ||
+ | == Reaction(s) of unknown directionality == | ||
+ | {{#set: common-name=red chlorophyll catabolite}} | ||
+ | {{#set: inchi-key=inchikey=gvtpycxgtfqzdt-yssugppcsa-m}} | ||
+ | {{#set: molecular-weight=624.692}} |
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite CPD-7063
- common-name:
- red chlorophyll catabolite
- smiles:
- ccc1(c(c)=c(nc=1c=c4(c(c)=c5(c(=o)[c-](c(oc)=o)c(c2(c(ccc(=o)[o-])c(c)c(n=2)=cc3(c(c)=c(c=c)c(=o)n3)))=c(n4)5)))c=o)
- inchi-key:
- gvtpycxgtfqzdt-yssugppcsa-m
- molecular-weight:
- 624.692