Difference between revisions of "CPD-7063"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ06722 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * DNA-DIRECTED-DNA-POLYMER...")
(Created page with "Category:metabolite == Metabolite CPD-7063 == * common-name: ** red chlorophyll catabolite * smiles: ** ccc1(c(c)=c(nc=1c=c4(c(c)=c5(c(=o)[c-](c(oc)=o)c(c2(c(ccc(=o)[o-])c...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ06722 ==
+
== Metabolite CPD-7063 ==
== Organism(s) associated with this gene  ==
+
* common-name:
* [[S.japonica_carotenoid_curated]]
+
** red chlorophyll catabolite
== Reaction(s) associated ==
+
* smiles:
* [[DNA-DIRECTED-DNA-POLYMERASE-RXN]]
+
** ccc1(c(c)=c(nc=1c=c4(c(c)=c5(c(=o)[c-](c(oc)=o)c(c2(c(ccc(=o)[o-])c(c)c(n=2)=cc3(c(c)=c(c=c)c(=o)n3)))=c(n4)5)))c=o)
** Category: [[orthology]]
+
* inchi-key:
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
** gvtpycxgtfqzdt-yssugppcsa-m
{{#set: organism associated=S.japonica_carotenoid_curated}}
+
* molecular-weight:
{{#set: nb reaction associated=1}}
+
** 624.692
 +
== Reaction(s) known to consume the compound ==
 +
* [[RXN-7741]]
 +
== Reaction(s) known to produce the compound ==
 +
* [[RXN-7740]]
 +
== Reaction(s) of unknown directionality ==
 +
{{#set: common-name=red chlorophyll catabolite}}
 +
{{#set: inchi-key=inchikey=gvtpycxgtfqzdt-yssugppcsa-m}}
 +
{{#set: molecular-weight=624.692}}

Latest revision as of 11:14, 18 March 2021

Metabolite CPD-7063

  • common-name:
    • red chlorophyll catabolite
  • smiles:
    • ccc1(c(c)=c(nc=1c=c4(c(c)=c5(c(=o)[c-](c(oc)=o)c(c2(c(ccc(=o)[o-])c(c)c(n=2)=cc3(c(c)=c(c=c)c(=o)n3)))=c(n4)5)))c=o)
  • inchi-key:
    • gvtpycxgtfqzdt-yssugppcsa-m
  • molecular-weight:
    • 624.692

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality