Difference between revisions of "CPD-7066"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite GLUTACONYL-COA == * common-name: ** (e)-glutaconyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(c=ccc(=o)[o-])=o)cop(=o)(op(=o)(occ1(c(o...") |
(Created page with "Category:metabolite == Metabolite CPD-7066 == * common-name: ** (2r,3s)-3-methylmalate * smiles: ** cc(c(=o)[o-])c(o)c([o-])=o * inchi-key: ** npyqjihhtgfbln-sthayslisa-l...") |
||
(2 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-7066 == |
* common-name: | * common-name: | ||
− | ** ( | + | ** (2r,3s)-3-methylmalate |
* smiles: | * smiles: | ||
− | ** cc(c | + | ** cc(c(=o)[o-])c(o)c([o-])=o |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** npyqjihhtgfbln-sthayslisa-l |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 146.099 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-7745]] |
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name=( | + | {{#set: common-name=(2r,3s)-3-methylmalate}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=npyqjihhtgfbln-sthayslisa-l}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=146.099}} |
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite CPD-7066
- common-name:
- (2r,3s)-3-methylmalate
- smiles:
- cc(c(=o)[o-])c(o)c([o-])=o
- inchi-key:
- npyqjihhtgfbln-sthayslisa-l
- molecular-weight:
- 146.099