Difference between revisions of "CPD-7087"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-157 == * common-name: ** (2z,4e)-2-hydroxy-6-oxonona-2,4-diene-1,9-dioate * smiles: ** c([o-])(=o)ccc(=o)c=cc=c(c([o-])=o)o * inchi-k...")
(Created page with "Category:metabolite == Metabolite cis-D21-39-oxo-40-Me-C59-1-ACPs == * common-name: ** a cis-delta21-39-oxo-40-methyl-c59:1-[acp] == Reaction(s) known to consume the compo...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-157 ==
+
== Metabolite cis-D21-39-oxo-40-Me-C59-1-ACPs ==
 
* common-name:
 
* common-name:
** (2z,4e)-2-hydroxy-6-oxonona-2,4-diene-1,9-dioate
+
** a cis-delta21-39-oxo-40-methyl-c59:1-[acp]
* smiles:
 
** c([o-])(=o)ccc(=o)c=cc=c(c([o-])=o)o
 
* inchi-key:
 
** rfenovfrmprrji-ydcwotkksa-l
 
* molecular-weight:
 
** 212.159
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[MHPCHYDROL-RXN]]
+
* [[RXN1G-3641]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(2z,4e)-2-hydroxy-6-oxonona-2,4-diene-1,9-dioate}}
+
{{#set: common-name=a cis-delta21-39-oxo-40-methyl-c59:1-[acp]}}
{{#set: inchi-key=inchikey=rfenovfrmprrji-ydcwotkksa-l}}
 
{{#set: molecular-weight=212.159}}
 

Revision as of 18:58, 14 January 2021

Metabolite cis-D21-39-oxo-40-Me-C59-1-ACPs

  • common-name:
    • a cis-delta21-39-oxo-40-methyl-c59:1-[acp]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a cis-delta21-39-oxo-40-methyl-c59:1-[acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.