Difference between revisions of "CPD-7087"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-10488 == * common-name: ** n-formyl-d-kynurenine * smiles: ** c(=o)nc1(c(c(=o)cc([n+])c(=o)[o-])=cc=cc=1) * inchi-key: ** byhjhxptqmm...") |
(Created page with "Category:metabolite == Metabolite CPD-7087 == * common-name: ** (+)-dihydromyricetin * smiles: ** c3(c(c2(oc1(c=c(c=c(c=1c(c2o)=o)o)[o-])))=cc(=c(c=3o)o)o) * inchi-key: **...") |
||
| (5 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-7087 == |
* common-name: | * common-name: | ||
| − | ** | + | ** (+)-dihydromyricetin |
* smiles: | * smiles: | ||
| − | ** c(= | + | ** c3(c(c2(oc1(c=c(c=c(c=1c(c2o)=o)o)[o-])))=cc(=c(c=3o)o)o) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** kjxsixmjhkajod-lsdhhaiusa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 319.247 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-7784]] | ||
| + | * [[RXN-8450]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-7922]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(+)-dihydromyricetin}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=kjxsixmjhkajod-lsdhhaiusa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=319.247}} |
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite CPD-7087
- common-name:
- (+)-dihydromyricetin
- smiles:
- c3(c(c2(oc1(c=c(c=c(c=1c(c2o)=o)o)[o-])))=cc(=c(c=3o)o)o)
- inchi-key:
- kjxsixmjhkajod-lsdhhaiusa-m
- molecular-weight:
- 319.247
