Difference between revisions of "CPD-7087"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=THIAZOLSYN3-RXN THIAZOLSYN3-RXN] == * direction: ** left-to-right * ec-number: ** [http://enzyme.ex...")
 
(Created page with "Category:metabolite == Metabolite CPD-7087 == * common-name: ** (+)-dihydromyricetin * smiles: ** c3(c(c2(oc1(c=c(c=c(c=1c(c2o)=o)o)[o-])))=cc(=c(c=3o)o)o) * inchi-key: **...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=THIAZOLSYN3-RXN THIAZOLSYN3-RXN] ==
+
== Metabolite CPD-7087 ==
−
* direction:
+
* common-name:
−
** left-to-right
+
** (+)-dihydromyricetin
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/2.7.1.50 ec-2.7.1.50]
+
** c3(c(c2(oc1(c=c(c=c(c=1c(c2o)=o)o)[o-])))=cc(=c(c=3o)o)o)
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[ATP]][c] '''+''' 1 [[THZ]][c] '''=>''' 1 [[ADP]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[THZ-P]][c]
+
** kjxsixmjhkajod-lsdhhaiusa-m
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ00229]]
+
** 319.247
−
** Category: [[orthology]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[RXN-7784]]
−
== Pathway(s) ==
+
* [[RXN-8450]]
−
* [[PWY-7357]], thiamine formation from pyrithiamine and oxythiamine (yeast): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7357 PWY-7357]
+
== Reaction(s) known to produce the compound ==
−
** '''4''' reactions found over '''6''' reactions in the full pathway
+
* [[RXN-7922]]
−
* [[PWY-7356]], thiamine salvage IV (yeast): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7356 PWY-7356]
+
== Reaction(s) of unknown directionality ==
−
** '''6''' reactions found over '''7''' reactions in the full pathway
+
{{#set: common-name=(+)-dihydromyricetin}}
−
* [[PWY-6897]], thiamine salvage II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6897 PWY-6897]
+
{{#set: inchi-key=inchikey=kjxsixmjhkajod-lsdhhaiusa-m}}
−
** '''3''' reactions found over '''3''' reactions in the full pathway
+
{{#set: molecular-weight=319.247}}
−
== Reconstruction information  ==
 
−
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
== External links  ==
 
−
* RHEA:
 
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=24213 24213]
 
−
* LIGAND-RXN:
 
−
** [http://www.genome.jp/dbget-bin/www_bget?R04448 R04448]
 
−
* UNIPROT:
 
−
** [http://www.uniprot.org/uniprot/P41835 P41835]
 
−
** [http://www.uniprot.org/uniprot/O28204 O28204]
 
−
** [http://www.uniprot.org/uniprot/P76423 P76423]
 
−
** [http://www.uniprot.org/uniprot/Q57233 Q57233]
 
−
** [http://www.uniprot.org/uniprot/Q9CG46 Q9CG46]
 
−
** [http://www.uniprot.org/uniprot/P39593 P39593]
 
−
** [http://www.uniprot.org/uniprot/P40386 P40386]
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: ec-number=ec-2.7.1.50}}
 
−
{{#set: nb gene associated=1}}
 
−
{{#set: nb pathway associated=3}}
 
−
{{#set: reconstruction category=orthology}}
 
−
{{#set: reconstruction tool=pantograph}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus}}
 

Latest revision as of 11:16, 18 March 2021

Metabolite CPD-7087

  • common-name:
    • (+)-dihydromyricetin
  • smiles:
    • c3(c(c2(oc1(c=c(c=c(c=1c(c2o)=o)o)[o-])))=cc(=c(c=3o)o)o)
  • inchi-key:
    • kjxsixmjhkajod-lsdhhaiusa-m
  • molecular-weight:
    • 319.247

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-7087&oldid=139264"