Difference between revisions of "CPD-7087"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-8323 RXN-8323] == * direction: ** left-to-right * common-name: ** 1-18:2-2-18:2-sn-glycerol-3-p...")
(Created page with "Category:metabolite == Metabolite CPD-7087 == * common-name: ** (+)-dihydromyricetin * smiles: ** c3(c(c2(oc1(c=c(c=c(c=1c(c2o)=o)o)[o-])))=cc(=c(c=3o)o)o) * inchi-key: **...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-8323 RXN-8323] ==
+
== Metabolite CPD-7087 ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** 1-18:2-2-18:2-sn-glycerol-3-phosphocholine desaturase
+
** (+)-dihydromyricetin
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/1.14.19.25 ec-1.14.19.25]
+
** c3(c(c2(oc1(c=c(c=c(c=1c(c2o)=o)o)[o-])))=cc(=c(c=3o)o)o)
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[CPD-2182]][c] '''+''' 2 [[FERROCYTOCHROME-B5]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''+''' 2 [[PROTON]][c] '''=>''' 1 [[CPD-8090]][c] '''+''' 2 [[FERRICYTOCHROME-B5]][c] '''+''' 2 [[WATER]][c]
+
** kjxsixmjhkajod-lsdhhaiusa-m
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ03069]]
+
** 319.247
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[RXN-7784]]
−
* Gene: [[SJ09228]]
+
* [[RXN-8450]]
−
** Category: [[annotation]]
+
== Reaction(s) known to produce the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[RXN-7922]]
−
== Pathway(s) ==
+
== Reaction(s) of unknown directionality ==
−
* [[PWY-762]], phospholipid desaturation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-762 PWY-762]
+
{{#set: common-name=(+)-dihydromyricetin}}
−
** '''19''' reactions found over '''21''' reactions in the full pathway
+
{{#set: inchi-key=inchikey=kjxsixmjhkajod-lsdhhaiusa-m}}
−
== Reconstruction information  ==
+
{{#set: molecular-weight=319.247}}
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== External links  ==
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=1-18:2-2-18:2-sn-glycerol-3-phosphocholine desaturase}}
 
−
{{#set: ec-number=ec-1.14.19.25}}
 
−
{{#set: nb gene associated=2}}
 
−
{{#set: nb pathway associated=1}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Latest revision as of 11:16, 18 March 2021

Metabolite CPD-7087

  • common-name:
    • (+)-dihydromyricetin
  • smiles:
    • c3(c(c2(oc1(c=c(c=c(c=1c(c2o)=o)o)[o-])))=cc(=c(c=3o)o)o)
  • inchi-key:
    • kjxsixmjhkajod-lsdhhaiusa-m
  • molecular-weight:
    • 319.247

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-7087&oldid=139264"