Difference between revisions of "CPD-7088"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite SIROHYDROCHLORIN == * common-name: ** sirohydrochlorin * smiles: ** cc2(cc(=o)[o-])(c1(=cc5(=nc(=cc4(nc(c=c3(n=c(c=c(n1)c(ccc(=o)[o-])2)c...")
(Created page with "Category:metabolite == Metabolite CPD-7088 == * common-name: ** (2r,3s,4s)-leucodelphinidin * smiles: ** c3(c(c2(oc1(=cc(=cc(=c1c(c2o)o)o)o)))=cc(o)=c(c(o)=3)o) * inchi-ke...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite SIROHYDROCHLORIN ==
+
== Metabolite CPD-7088 ==
 
* common-name:
 
* common-name:
** sirohydrochlorin
+
** (2r,3s,4s)-leucodelphinidin
 
* smiles:
 
* smiles:
** cc2(cc(=o)[o-])(c1(=cc5(=nc(=cc4(nc(c=c3(n=c(c=c(n1)c(ccc(=o)[o-])2)c(cc(=o)[o-])=c(ccc(=o)[o-])3))=c(ccc(=o)[o-])c(cc(=o)[o-])=4))c(c)(cc(=o)[o-])c(ccc(=o)[o-])5)))
+
** c3(c(c2(oc1(=cc(=cc(=c1c(c2o)o)o)o)))=cc(o)=c(c(o)=3)o)
 
* inchi-key:
 
* inchi-key:
** kwizrxmmfrbuml-ahgfgahvsa-f
+
** zeacokjoqlaytd-souvjxgzsa-n
 
* molecular-weight:
 
* molecular-weight:
** 854.779
+
** 322.271
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[4.99.1.3-RXN]]
 
* [[SIROHEME-FERROCHELAT-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[DIMETHUROPORDEHYDROG-RXN]]
+
* [[RXN-7784]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=sirohydrochlorin}}
+
{{#set: common-name=(2r,3s,4s)-leucodelphinidin}}
{{#set: inchi-key=inchikey=kwizrxmmfrbuml-ahgfgahvsa-f}}
+
{{#set: inchi-key=inchikey=zeacokjoqlaytd-souvjxgzsa-n}}
{{#set: molecular-weight=854.779}}
+
{{#set: molecular-weight=322.271}}

Latest revision as of 11:11, 18 March 2021

Metabolite CPD-7088

  • common-name:
    • (2r,3s,4s)-leucodelphinidin
  • smiles:
    • c3(c(c2(oc1(=cc(=cc(=c1c(c2o)o)o)o)))=cc(o)=c(c(o)=3)o)
  • inchi-key:
    • zeacokjoqlaytd-souvjxgzsa-n
  • molecular-weight:
    • 322.271

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality