Difference between revisions of "CPD-709"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-9245 == * common-name: ** palmitoleate * smiles: ** ccccccc=ccccccccc(=o)[o-] * inchi-key: ** secpzkhbenqxjg-fplpwbnlsa-m * molecular...") |
(Created page with "Category:metabolite == Metabolite CPD-709 == * common-name: ** (5α)-campestan-3-one * smiles: ** cc(c)c(c)ccc(c)[ch]3(cc[ch]4([ch]2(cc[ch]1(cc(=o)ccc(c)1[ch]2ccc(c)3...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-709 == |
* common-name: | * common-name: | ||
| − | ** | + | ** (5α)-campestan-3-one |
* smiles: | * smiles: | ||
| − | ** | + | ** cc(c)c(c)ccc(c)[ch]3(cc[ch]4([ch]2(cc[ch]1(cc(=o)ccc(c)1[ch]2ccc(c)34)))) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** ddjmomhmvfxeqf-jbqstxlysa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 400.687 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-711]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(5α)-campestan-3-one}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ddjmomhmvfxeqf-jbqstxlysa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=400.687}} |
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite CPD-709
- common-name:
- (5α)-campestan-3-one
- smiles:
- cc(c)c(c)ccc(c)[ch]3(cc[ch]4([ch]2(cc[ch]1(cc(=o)ccc(c)1[ch]2ccc(c)34))))
- inchi-key:
- ddjmomhmvfxeqf-jbqstxlysa-n
- molecular-weight:
- 400.687
