Difference between revisions of "CPD-709"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite DCDP == * common-name: ** dcdp * smiles: ** c(c2(c(cc(n1(c(n=c(c=c1)n)=o))o2)o))op(op(=o)([o-])[o-])([o-])=o * inchi-key: ** ftdhdkpuhblb...") |
(Created page with "Category:metabolite == Metabolite Oxidized-2Fe-2S-Ferredoxins == * common-name: ** an oxidized [2fe-2s] ferredoxin == Reaction(s) known to consume the compound == == React...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Oxidized-2Fe-2S-Ferredoxins == |
* common-name: | * common-name: | ||
| − | ** | + | ** an oxidized [2fe-2s] ferredoxin |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[2.8.1.6-RXN]] |
| − | + | * [[RXN-11586]] | |
| − | * [[ | + | * [[RXN-14950]] |
| − | * [[ | + | * [[RXN-14957]] |
| − | * [[ | + | * [[RXN-14959]] |
| − | * [[ | + | * [[RXN-17472]] |
| − | + | * [[RXN0-949]] | |
| − | * [[RXN- | ||
| − | * [[ | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=an oxidized [2fe-2s] ferredoxin}} |
| − | |||
| − | |||
Revision as of 13:09, 14 January 2021
Contents
Metabolite Oxidized-2Fe-2S-Ferredoxins
- common-name:
- an oxidized [2fe-2s] ferredoxin
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "an oxidized [2fe-2s] ferredoxin" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
