Difference between revisions of "CPD-71"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite LYS == * common-name: ** l-lysine * smiles: ** c([n+])cccc([n+])c([o-])=o * inchi-key: ** kdxkernsbixsrk-yfkpbyrvsa-o * molecular-weight:...") |
(Created page with "Category:metabolite == Metabolite THIAMINE-P == * common-name: ** thiamine phosphate * smiles: ** cc1([n+](=csc(ccop([o-])(=o)[o-])=1)cc2(c=nc(c)=nc(n)=2)) * inchi-key: **...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite THIAMINE-P == |
* common-name: | * common-name: | ||
| − | ** | + | ** thiamine phosphate |
* smiles: | * smiles: | ||
| − | ** | + | ** cc1([n+](=csc(ccop([o-])(=o)[o-])=1)cc2(c=nc(c)=nc(n)=2)) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** hzsajdvwzrbgif-uhfffaoysa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 343.317 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN0-3542]] |
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-12610]] |
| − | * [[ | + | * [[RXN-12611]] |
| + | * [[RXN0-3542]] | ||
| + | * [[THI-P-SYN-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=thiamine phosphate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=hzsajdvwzrbgif-uhfffaoysa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=343.317}} |
Revision as of 08:27, 15 March 2021
Contents
Metabolite THIAMINE-P
- common-name:
- thiamine phosphate
- smiles:
- cc1([n+](=csc(ccop([o-])(=o)[o-])=1)cc2(c=nc(c)=nc(n)=2))
- inchi-key:
- hzsajdvwzrbgif-uhfffaoysa-m
- molecular-weight:
- 343.317
