Difference between revisions of "CPD-71"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite THIAMINE-P == * common-name: ** thiamine phosphate * smiles: ** cc1([n+](=csc(ccop([o-])(=o)[o-])=1)cc2(c=nc(c)=nc(n)=2)) * inchi-key: **...")
(Created page with "Category:metabolite == Metabolite CPD-71 == * common-name: ** (25r)-3α,7α,12α-trihydroxy-5β-cholestanoyl-coa * smiles: ** cc(cccc(c)c(sccnc(=o)ccnc(...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite THIAMINE-P ==
+
== Metabolite CPD-71 ==
 
* common-name:
 
* common-name:
** thiamine phosphate
+
** (25r)-3α,7α,12α-trihydroxy-5β-cholestanoyl-coa
 
* smiles:
 
* smiles:
** cc1([n+](=csc(ccop([o-])(=o)[o-])=1)cc2(c=nc(c)=nc(n)=2))
+
** cc(cccc(c)c(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o)[ch]4(cc[ch]5(c(c)4c(o)c[ch]6([ch]5c(o)c[ch]7(c(c)6ccc(o)c7))))
 
* inchi-key:
 
* inchi-key:
** hzsajdvwzrbgif-uhfffaoysa-m
+
** mnydliunnocphg-fjwdchqmsa-j
 
* molecular-weight:
 
* molecular-weight:
** 343.317
+
** 1196.145
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN0-3542]]
+
* [[1.17.99.3-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-12610]]
+
* [[1.17.99.3-RXN]]
* [[RXN-12611]]
 
* [[RXN0-3542]]
 
* [[THI-P-SYN-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=thiamine phosphate}}
+
{{#set: common-name=(25r)-3α,7α,12α-trihydroxy-5β-cholestanoyl-coa}}
{{#set: inchi-key=inchikey=hzsajdvwzrbgif-uhfffaoysa-m}}
+
{{#set: inchi-key=inchikey=mnydliunnocphg-fjwdchqmsa-j}}
{{#set: molecular-weight=343.317}}
+
{{#set: molecular-weight=1196.145}}

Latest revision as of 11:14, 18 March 2021

Metabolite CPD-71

  • common-name:
    • (25r)-3α,7α,12α-trihydroxy-5β-cholestanoyl-coa
  • smiles:
    • cc(cccc(c)c(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o)[ch]4(cc[ch]5(c(c)4c(o)c[ch]6([ch]5c(o)c[ch]7(c(c)6ccc(o)c7))))
  • inchi-key:
    • mnydliunnocphg-fjwdchqmsa-j
  • molecular-weight:
    • 1196.145

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality