Difference between revisions of "CPD-7100"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ15347 == * transcription-direction: ** positive * right-end-position: ** 134124 * left-end-position: ** 113142 * centisome-position: ** 38.15816...")
(Created page with "Category:metabolite == Metabolite CPD-734 == * common-name: ** (-)-jasmonate * smiles: ** ccc=ccc1(c(=o)ccc1cc([o-])=o) * inchi-key: ** znjfbwydhiglcu-hwkxxfmvsa-m * molec...")
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ15347 ==
+
== Metabolite CPD-734 ==
−
* transcription-direction:
+
* common-name:
−
** positive
+
** (-)-jasmonate
−
* right-end-position:
+
* smiles:
−
** 134124
+
** ccc=ccc1(c(=o)ccc1cc([o-])=o)
−
* left-end-position:
+
* inchi-key:
−
** 113142
+
** znjfbwydhiglcu-hwkxxfmvsa-m
−
* centisome-position:
+
* molecular-weight:
−
** 38.15816   
+
** 209.264
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
== Reaction(s) known to produce the compound ==
−
== Reaction(s) associated ==
+
* [[RXN-10767]]
−
* [[CHOLINE-KINASE-RXN]]
+
== Reaction(s) of unknown directionality ==
−
** Category: [[annotation]]
+
{{#set: common-name=(-)-jasmonate}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=znjfbwydhiglcu-hwkxxfmvsa-m}}
−
* [[ETHANOLAMINE-KINASE-RXN]]
+
{{#set: molecular-weight=209.264}}
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== Pathway(s) associated ==
 
−
* [[PWY-7782]]
 
−
** '''11''' reactions found over '''16''' reactions in the full pathway
 
−
* [[PWY3O-450]]
 
−
** '''3''' reactions found over '''3''' reactions in the full pathway
 
−
* [[PWY-7818]]
 
−
** '''2''' reactions found over '''19''' reactions in the full pathway
 
−
* [[PWY-7886]]
 
−
** '''2''' reactions found over '''3''' reactions in the full pathway
 
−
* [[PWY-3385]]
 
−
** '''2''' reactions found over '''6''' reactions in the full pathway
 
−
* [[PWY4FS-6]]
 
−
** '''3''' reactions found over '''4''' reactions in the full pathway
 
−
{{#set: transcription-direction=positive}}
 
−
{{#set: right-end-position=134124}}
 
−
{{#set: left-end-position=113142}}
 
−
{{#set: centisome-position=38.15816    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=2}}
 
−
{{#set: nb pathway associated=6}}
 

Revision as of 20:30, 18 December 2020

Metabolite CPD-734

  • common-name:
    • (-)-jasmonate
  • smiles:
    • ccc=ccc1(c(=o)ccc1cc([o-])=o)
  • inchi-key:
    • znjfbwydhiglcu-hwkxxfmvsa-m
  • molecular-weight:
    • 209.264

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-7100&oldid=45749"