Difference between revisions of "CPD-7105"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-7105 == * common-name: ** deoxyhumulone * smiles: ** cc(=ccc1(=c(c(=c(c(=c1[o-])cc=c(c)c)o)c(cc(c)c)=o)o))c * inchi-key: ** nqybqbzoh...") |
(Created page with "Category:metabolite == Metabolite 2K-4CH3-PENTANOATE == * common-name: ** 4-methyl-2-oxopentanoate * smiles: ** cc(c)cc(c([o-])=o)=o * inchi-key: ** bkajnaxtpsgjcu-uhfffao...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 2K-4CH3-PENTANOATE == |
* common-name: | * common-name: | ||
| − | ** | + | ** 4-methyl-2-oxopentanoate |
* smiles: | * smiles: | ||
| − | ** cc( | + | ** cc(c)cc(c([o-])=o)=o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** bkajnaxtpsgjcu-uhfffaoysa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 129.135 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[BRANCHED-CHAINAMINOTRANSFERLEU-RXN]] | ||
| + | * [[KETOISOCAPROATE-RXN]] | ||
| + | * [[RXN-17525]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[BRANCHED-CHAINAMINOTRANSFERLEU-RXN]] |
| + | * [[RXN-13158]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=4-methyl-2-oxopentanoate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=bkajnaxtpsgjcu-uhfffaoysa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=129.135}} |
Revision as of 08:28, 15 March 2021
Contents
Metabolite 2K-4CH3-PENTANOATE
- common-name:
- 4-methyl-2-oxopentanoate
- smiles:
- cc(c)cc(c([o-])=o)=o
- inchi-key:
- bkajnaxtpsgjcu-uhfffaoysa-m
- molecular-weight:
- 129.135
