Difference between revisions of "CPD-7105"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ09694 == * transcription-direction: ** negative * right-end-position: ** 21027 * left-end-position: ** 15741 * centisome-position: ** 42.13668...")
 
(Created page with "Category:metabolite == Metabolite CPD-7105 == * common-name: ** deoxyhumulone * smiles: ** cc(=ccc1(=c(c(=c(c(=c1[o-])cc=c(c)c)o)c(cc(c)c)=o)o))c * inchi-key: ** nqybqbzoh...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ09694 ==
+
== Metabolite CPD-7105 ==
−
* transcription-direction:
+
* common-name:
−
** negative
+
** deoxyhumulone
−
* right-end-position:
+
* smiles:
−
** 21027
+
** cc(=ccc1(=c(c(=c(c(=c1[o-])cc=c(c)c)o)c(cc(c)c)=o)o))c
−
* left-end-position:
+
* inchi-key:
−
** 15741
+
** nqybqbzohcaccr-uhfffaoysa-m
−
* centisome-position:
+
* molecular-weight:
−
** 42.13668   
+
** 345.458
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
== Reaction(s) known to produce the compound ==
−
== Reaction(s) associated ==
+
* [[RXN-7810]]
−
* [[RXN-11783]]
+
== Reaction(s) of unknown directionality ==
−
** Category: [[annotation]]
+
{{#set: common-name=deoxyhumulone}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=nqybqbzohcaccr-uhfffaoysa-m}}
−
* [[RXN-11989]]
+
{{#set: molecular-weight=345.458}}
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* [[RXN-11999]]
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
== Pathway(s) associated ==
 
−
* [[PWY-6681]]
 
−
** '''3''' reactions found over '''7''' reactions in the full pathway
 
−
{{#set: transcription-direction=negative}}
 
−
{{#set: right-end-position=21027}}
 
−
{{#set: left-end-position=15741}}
 
−
{{#set: centisome-position=42.13668    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=3}}
 
−
{{#set: nb pathway associated=1}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite CPD-7105

  • common-name:
    • deoxyhumulone
  • smiles:
    • cc(=ccc1(=c(c(=c(c(=c1[o-])cc=c(c)c)o)c(cc(c)c)=o)o))c
  • inchi-key:
    • nqybqbzohcaccr-uhfffaoysa-m
  • molecular-weight:
    • 345.458

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-7105&oldid=138412"