Difference between revisions of "CPD-7109"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16065 RXN-16065] == * direction: ** left-to-right * ec-number: ** [http://enzyme.expasy.org/EC/...")
(Created page with "Category:metabolite == Metabolite CPD-7109 == * common-name: ** 4-prenylphlorisovalerophenone * smiles: ** cc(=ccc1(=c(c=c(c(=c1o)c(cc(c)c)=o)o)[o-]))c * inchi-key: ** lwl...")
 
(7 intermediate revisions by 2 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16065 RXN-16065] ==
+
== Metabolite CPD-7109 ==
−
* direction:
+
* common-name:
−
** left-to-right
+
** 4-prenylphlorisovalerophenone
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/1.14.19.3 ec-1.14.19.3]
+
** cc(=ccc1(=c(c=c(c(=c1o)c(cc(c)c)=o)o)[o-]))c
−
== Reaction formula ==
+
* inchi-key:
−
* 2 [[FERROCYTOCHROME-B5]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''+''' 1 [[PALMITYL-COA]][c] '''+''' 2 [[PROTON]][c] '''=>''' 1 [[CPD-17313]][c] '''+''' 2 [[FERRICYTOCHROME-B5]][c] '''+''' 2 [[WATER]][c]
+
** lwlgkghhvbvdkb-uhfffaoysa-m
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ05483]]
+
** 277.339
−
** Category: [[orthology]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[RXN-7810]]
−
== Pathway(s) ==
+
== Reaction(s) known to produce the compound ==
−
== Reconstruction information  ==
+
* [[RXN-7811]]
−
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
== Reaction(s) of unknown directionality ==
−
== External links  ==
+
{{#set: common-name=4-prenylphlorisovalerophenone}}
−
{{#set: direction=left-to-right}}
+
{{#set: inchi-key=inchikey=lwlgkghhvbvdkb-uhfffaoysa-m}}
−
{{#set: ec-number=ec-1.14.19.3}}
+
{{#set: molecular-weight=277.339}}
−
{{#set: nb gene associated=1}}
 
−
{{#set: nb pathway associated=0}}
 
−
{{#set: reconstruction category=orthology}}
 
−
{{#set: reconstruction tool=pantograph}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite CPD-7109

  • common-name:
    • 4-prenylphlorisovalerophenone
  • smiles:
    • cc(=ccc1(=c(c=c(c(=c1o)c(cc(c)c)=o)o)[o-]))c
  • inchi-key:
    • lwlgkghhvbvdkb-uhfffaoysa-m
  • molecular-weight:
    • 277.339

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-7109&oldid=138787"