Difference between revisions of "CPD-7117"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite DIETHYLTHIOPHOSPHATE == * common-name: ** diethylthiophosphate * smiles: ** ccop(=s)([o-])occ * inchi-key: ** pkuwkaxtavnijr-uhfffaoysa-m...") |
(Created page with "Category:metabolite == Metabolite CPD-7117 == * common-name: ** delphinidin-3-o-β-d-glucoside * smiles: ** c(o)c1(c(o)c(o)c(o)c(o1)oc3(c(c2(c=c(o)c(o)=c(o)c=2))=[o+]c...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-7117 == |
* common-name: | * common-name: | ||
| − | ** | + | ** delphinidin-3-o-β-d-glucoside |
* smiles: | * smiles: | ||
| − | ** | + | ** c(o)c1(c(o)c(o)c(o)c(o1)oc3(c(c2(c=c(o)c(o)=c(o)c=2))=[o+]c4(c(c=3)=c([o-])c=c([o-])c=4))) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** xenhpqqldpayij-pevlunpasa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 463.374 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-8228]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=delphinidin-3-o-β-d-glucoside}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=xenhpqqldpayij-pevlunpasa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=463.374}} |
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite CPD-7117
- common-name:
- delphinidin-3-o-β-d-glucoside
- smiles:
- c(o)c1(c(o)c(o)c(o)c(o1)oc3(c(c2(c=c(o)c(o)=c(o)c=2))=[o+]c4(c(c=3)=c([o-])c=c([o-])c=4)))
- inchi-key:
- xenhpqqldpayij-pevlunpasa-m
- molecular-weight:
- 463.374
