Difference between revisions of "CPD-7117"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ12433 == * transcription-direction: ** negative * right-end-position: ** 342378 * left-end-position: ** 331738 * centisome-position: ** 92.67408...")
(Created page with "Category:metabolite == Metabolite CPD-7117 == * common-name: ** delphinidin-3-o-β-d-glucoside * smiles: ** c(o)c1(c(o)c(o)c(o)c(o1)oc3(c(c2(c=c(o)c(o)=c(o)c=2))=[o+]c...")
 
(8 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ12433 ==
+
== Metabolite CPD-7117 ==
* transcription-direction:
+
* common-name:
** negative
+
** delphinidin-3-o-β-d-glucoside
* right-end-position:
+
* smiles:
** 342378
+
** c(o)c1(c(o)c(o)c(o)c(o1)oc3(c(c2(c=c(o)c(o)=c(o)c=2))=[o+]c4(c(c=3)=c([o-])c=c([o-])c=4)))
* left-end-position:
+
* inchi-key:
** 331738
+
** xenhpqqldpayij-pevlunpasa-m
* centisome-position:
+
* molecular-weight:
** 92.67408   
+
** 463.374
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-8228]]
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
* [[ACYLPYRUVATE-HYDROLASE-RXN]]
+
== Reaction(s) of unknown directionality ==
** Category: [[annotation]]
+
{{#set: common-name=delphinidin-3-o-β-d-glucoside}}
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=xenhpqqldpayij-pevlunpasa-m}}
* [[RXN-10445]]
+
{{#set: molecular-weight=463.374}}
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
== Pathway(s) associated ==
 
* [[PWY-7044]]
 
** '''1''' reactions found over '''6''' reactions in the full pathway
 
* [[PWY-6223]]
 
** '''1''' reactions found over '''3''' reactions in the full pathway
 
{{#set: transcription-direction=negative}}
 
{{#set: right-end-position=342378}}
 
{{#set: left-end-position=331738}}
 
{{#set: centisome-position=92.67408    }}
 
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=2}}
 
{{#set: nb pathway associated=2}}
 

Latest revision as of 11:12, 18 March 2021

Metabolite CPD-7117

  • common-name:
    • delphinidin-3-o-β-d-glucoside
  • smiles:
    • c(o)c1(c(o)c(o)c(o)c(o1)oc3(c(c2(c=c(o)c(o)=c(o)c=2))=[o+]c4(c(c=3)=c([o-])c=c([o-])c=4)))
  • inchi-key:
    • xenhpqqldpayij-pevlunpasa-m
  • molecular-weight:
    • 463.374

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality