Difference between revisions of "CPD-712"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11241 == * common-name: ** 4-(4-deoxy-α-d-galact-4-enuronosyl)-d-galacturonate * smiles: ** c([o-])(=o)c1(=cc(o)c(o)c(o1)oc2(c(...")
(Created page with "Category:metabolite == Metabolite CPD-712 == * common-name: ** 6-deoxocathasterone * smiles: ** cc(c)c(c)cc(o)c(c)[ch]3(cc[ch]4([ch]2(cc[ch]1(cc(o)ccc(c)1[ch]2ccc(c)34))))...")
 
(5 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-11241 ==
+
== Metabolite CPD-712 ==
 
* common-name:
 
* common-name:
** 4-(4-deoxy-α-d-galact-4-enuronosyl)-d-galacturonate
+
** 6-deoxocathasterone
 
* smiles:
 
* smiles:
** c([o-])(=o)c1(=cc(o)c(o)c(o1)oc2(c(o)c(c(o)oc(c([o-])=o)2)o))
+
** cc(c)c(c)cc(o)c(c)[ch]3(cc[ch]4([ch]2(cc[ch]1(cc(o)ccc(c)1[ch]2ccc(c)34))))
 
* inchi-key:
 
* inchi-key:
** llvvmxfnkahvez-gawnparcsa-l
+
** zhzkwzjlunxosn-yuzbouazsa-n
 
* molecular-weight:
 
* molecular-weight:
** 350.235
+
** 418.702
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-14897]]
+
* [[RXN-773]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=4-(4-deoxy-α-d-galact-4-enuronosyl)-d-galacturonate}}
+
{{#set: common-name=6-deoxocathasterone}}
{{#set: inchi-key=inchikey=llvvmxfnkahvez-gawnparcsa-l}}
+
{{#set: inchi-key=inchikey=zhzkwzjlunxosn-yuzbouazsa-n}}
{{#set: molecular-weight=350.235}}
+
{{#set: molecular-weight=418.702}}

Latest revision as of 11:14, 18 March 2021

Metabolite CPD-712

  • common-name:
    • 6-deoxocathasterone
  • smiles:
    • cc(c)c(c)cc(o)c(c)[ch]3(cc[ch]4([ch]2(cc[ch]1(cc(o)ccc(c)1[ch]2ccc(c)34))))
  • inchi-key:
    • zhzkwzjlunxosn-yuzbouazsa-n
  • molecular-weight:
    • 418.702

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality