Difference between revisions of "CPD-713"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite ARG == * common-name: ** l-arginine * smiles: ** c(nc(n)=[n+])ccc([n+])c(=o)[o-] * inchi-key: ** odksfydxxfifqn-bypyzucnsa-o * molecular-...")
(Created page with "Category:metabolite == Metabolite BETAINE_ALDEHYDE == * common-name: ** betaine aldehyde * smiles: ** c[n+](c)(c[ch]=o)c * inchi-key: ** sxknccspzdcrfd-uhfffaoysa-n * mole...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite ARG ==
+
== Metabolite BETAINE_ALDEHYDE ==
 
* common-name:
 
* common-name:
** l-arginine
+
** betaine aldehyde
 
* smiles:
 
* smiles:
** c(nc(n)=[n+])ccc([n+])c(=o)[o-]
+
** c[n+](c)(c[ch]=o)c
 
* inchi-key:
 
* inchi-key:
** odksfydxxfifqn-bypyzucnsa-o
+
** sxknccspzdcrfd-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 175.21
+
** 102.156
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[1.5.1.11-RXN]]
+
* [[BADH-RXN]]
* [[1.5.1.19-RXN]]
+
* [[CHD-RXN]]
* [[ARG-OXIDATION-RXN]]
 
* [[ARGDECARBOX-RXN]]
 
* [[ARGINASE-RXN]]
 
* [[ARGININE--TRNA-LIGASE-RXN]]
 
* [[ARGSUCCINLYA-RXN]]
 
* [[NITRIC-OXIDE-SYNTHASE-RXN]]
 
* [[RXN-13564]]
 
* [[biomass_rxn]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ARGDECARBOX-RXN]]
+
* [[BADH-RXN]]
* [[ARGINASE-RXN]]
+
* [[CHD-RXN]]
* [[ARGSUCCINLYA-RXN]]
+
* [[RXN0-7230]]
* [[D-OCTOPINE-DEHYDROGENASE-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=l-arginine}}
+
{{#set: common-name=betaine aldehyde}}
{{#set: inchi-key=inchikey=odksfydxxfifqn-bypyzucnsa-o}}
+
{{#set: inchi-key=inchikey=sxknccspzdcrfd-uhfffaoysa-n}}
{{#set: molecular-weight=175.21}}
+
{{#set: molecular-weight=102.156}}

Revision as of 15:29, 5 January 2021

Metabolite BETAINE_ALDEHYDE

  • common-name:
    • betaine aldehyde
  • smiles:
    • c[n+](c)(c[ch]=o)c
  • inchi-key:
    • sxknccspzdcrfd-uhfffaoysa-n
  • molecular-weight:
    • 102.156

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality