Difference between revisions of "CPD-713"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite ARG == * common-name: ** l-arginine * smiles: ** c(nc(n)=[n+])ccc([n+])c(=o)[o-] * inchi-key: ** odksfydxxfifqn-bypyzucnsa-o * molecular-...") |
(Created page with "Category:metabolite == Metabolite BETAINE_ALDEHYDE == * common-name: ** betaine aldehyde * smiles: ** c[n+](c)(c[ch]=o)c * inchi-key: ** sxknccspzdcrfd-uhfffaoysa-n * mole...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite BETAINE_ALDEHYDE == |
* common-name: | * common-name: | ||
− | ** | + | ** betaine aldehyde |
* smiles: | * smiles: | ||
− | ** c | + | ** c[n+](c)(c[ch]=o)c |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** sxknccspzdcrfd-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 102.156 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[BADH-RXN]] |
− | * [[ | + | * [[CHD-RXN]] |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[BADH-RXN]] |
− | * [[ | + | * [[CHD-RXN]] |
− | * [[ | + | * [[RXN0-7230]] |
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=betaine aldehyde}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=sxknccspzdcrfd-uhfffaoysa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=102.156}} |
Revision as of 15:29, 5 January 2021
Contents
Metabolite BETAINE_ALDEHYDE
- common-name:
- betaine aldehyde
- smiles:
- c[n+](c)(c[ch]=o)c
- inchi-key:
- sxknccspzdcrfd-uhfffaoysa-n
- molecular-weight:
- 102.156