|
|
| (8 intermediate revisions by 3 users not shown) |
| Line 1: |
Line 1: |
| − | [[Category:gene]] | + | [[Category:metabolite]] |
| − | == Gene SJ09590 == | + | == Metabolite CPD-7137 == |
| − | * transcription-direction: | + | * common-name: |
| − | ** negative | + | ** pelargonidin-3,5-di-o-β-d-glucoside |
| − | * right-end-position:
| + | * smiles: |
| − | ** 130172
| + | ** c(o)c5(c(c(c(c(oc3(=cc([o-])=cc2([o+]=c(c1(=cc=c(o)c=c1))c(=cc=23)oc4(c(o)c(o)c(o)c(co)o4))))o5)o)o)o) |
| − | * left-end-position:
| + | * inchi-key: |
| − | ** 115960 | + | ** slckjkwfulxzbd-zotffytfsa-n |
| − | * centisome-position:
| + | * molecular-weight: |
| − | ** 28.2067 | + | ** 594.525 |
| − | == Organism(s) associated with this gene == | + | == Reaction(s) known to consume the compound == |
| − | * [[S.japonica_carotenoid_curated]]
| + | == Reaction(s) known to produce the compound == |
| − | == Reaction(s) associated == | + | * [[RXN-7828]] |
| − | <div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
| + | == Reaction(s) of unknown directionality == |
| − | * [[3PGAREARR-RXN]] | + | {{#set: common-name=pelargonidin-3,5-di-o-β-d-glucoside}} |
| − | ** Category: [[annotation]]
| + | {{#set: inchi-key=inchikey=slckjkwfulxzbd-zotffytfsa-n}} |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| + | {{#set: molecular-weight=594.525}} |
| − | ** Category: [[orthology]]
| |
| − | *** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
| |
| − | *** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a | |
| − | *** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
| |
| − | * [[RXN-15509]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | * [[RXN-15510]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | * [[RXN-15511]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | * [[RXN-15512]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | * [[RXN-15513]] | |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a | |
| − | </div>
| |
| − | == Pathway(s) associated == | |
| − | <div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
| |
| − | * [[PWY-6142]]
| |
| − | ** '''10''' reactions found over '''13''' reactions in the full pathway
| |
| − | * [[PWY-7003]] | |
| − | ** '''8''' reactions found over '''6''' reactions in the full pathway
| |
| − | * [[PWY-7218]]
| |
| − | ** '''7''' reactions found over '''4''' reactions in the full pathway
| |
| − | * [[GLYCOLYSIS]]
| |
| − | ** '''11''' reactions found over '''12''' reactions in the full pathway
| |
| − | * [[P341-PWY]]
| |
| − | ** '''6''' reactions found over '''10''' reactions in the full pathway
| |
| − | * [[PWY-5723]]
| |
| − | ** '''10''' reactions found over '''10''' reactions in the full pathway
| |
| − | * [[P124-PWY]]
| |
| − | ** '''12''' reactions found over '''15''' reactions in the full pathway
| |
| − | * [[PWY-2221]]
| |
| − | ** '''6''' reactions found over '''9''' reactions in the full pathway
| |
| − | * [[PWY-5484]]
| |
| − | ** '''10''' reactions found over '''11''' reactions in the full pathway
| |
| − | * [[PWY-1042]]
| |
| − | ** '''9''' reactions found over '''10''' reactions in the full pathway
| |
| − | * [[PWY-6886]]
| |
| − | ** '''8''' reactions found over '''5''' reactions in the full pathway
| |
| − | * [[PWY-6901]]
| |
| − | ** '''10''' reactions found over '''8''' reactions in the full pathway
| |
| − | * [[PWY-7124]]
| |
| − | ** '''8''' reactions found over '''8''' reactions in the full pathway
| |
| − | * [[GLUCONEO-PWY]]
| |
| − | ** '''12''' reactions found over '''13''' reactions in the full pathway
| |
| − | * [[PWY-6405]]
| |
| − | ** '''2''' reactions found over '''3''' reactions in the full pathway
| |
| − | * [[P122-PWY]]
| |
| − | ** '''16''' reactions found over '''18''' reactions in the full pathway
| |
| − | * [[PWY-1622]]
| |
| − | ** '''6''' reactions found over '''13''' reactions in the full pathway
| |
| − | * [[ANAGLYCOLYSIS-PWY]]
| |
| − | ** '''10''' reactions found over '''11''' reactions in the full pathway
| |
| − | * [[PWY66-399]]
| |
| − | ** '''11''' reactions found over '''12''' reactions in the full pathway
| |
| − | </div>
| |
| − | {{#set: transcription-direction=negative}}
| |
| − | {{#set: right-end-position=130172}} | |
| − | {{#set: left-end-position=115960}}
| |
| − | {{#set: centisome-position=28.2067 }} | |
| − | {{#set: organism associated=S.japonica_carotenoid_curated}}
| |
| − | {{#set: nb reaction associated=6}}
| |
| − | {{#set: nb pathway associated=19}}
| |
