Difference between revisions of "CPD-7137"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Dietary-retinyl-esters == * common-name: ** a dietary all-trans-retinyl ester == Reaction(s) known to consume the compound == * RXN-125...")
(Created page with "Category:metabolite == Metabolite CPD-7137 == * common-name: ** pelargonidin-3,5-di-o-β-d-glucoside * smiles: ** c(o)c5(c(c(c(c(oc3(=cc([o-])=cc2([o+]=c(c1(=cc=c(o)c=...")
 
(6 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Dietary-retinyl-esters ==
+
== Metabolite CPD-7137 ==
 
* common-name:
 
* common-name:
** a dietary all-trans-retinyl ester
+
** pelargonidin-3,5-di-o-β-d-glucoside
 +
* smiles:
 +
** c(o)c5(c(c(c(c(oc3(=cc([o-])=cc2([o+]=c(c1(=cc=c(o)c=c1))c(=cc=23)oc4(c(o)c(o)c(o)c(co)o4))))o5)o)o)o)
 +
* inchi-key:
 +
** slckjkwfulxzbd-zotffytfsa-n
 +
* molecular-weight:
 +
** 594.525
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-12579]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-7828]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a dietary all-trans-retinyl ester}}
+
{{#set: common-name=pelargonidin-3,5-di-o-β-d-glucoside}}
 +
{{#set: inchi-key=inchikey=slckjkwfulxzbd-zotffytfsa-n}}
 +
{{#set: molecular-weight=594.525}}

Latest revision as of 11:13, 18 March 2021

Metabolite CPD-7137

  • common-name:
    • pelargonidin-3,5-di-o-β-d-glucoside
  • smiles:
    • c(o)c5(c(c(c(c(oc3(=cc([o-])=cc2([o+]=c(c1(=cc=c(o)c=c1))c(=cc=23)oc4(c(o)c(o)c(o)c(co)o4))))o5)o)o)o)
  • inchi-key:
    • slckjkwfulxzbd-zotffytfsa-n
  • molecular-weight:
    • 594.525

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality