Difference between revisions of "CPD-7158"

Revision as of 08:26, 15 March 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite CPD-12601 ==
+== Metabolite CPD-13524 ==
 * common-name:
-** &beta;-d-mannopyranose
+** all-trans-retinol
 * smiles:
-** c(o)c1(c(o)c(o)c(o)c(o)o1)
+** cc(=cc=cc(c)=cco)c=cc1(=c(c)cccc(c)(c)1)
 * inchi-key:
-** wqzgkkkjijffok-rwopyejcsa-n
+** fpipgxgpppqfeq-ovsjkpmpsa-n
 * molecular-weight:
-** 180.157
+** 286.456
 == Reaction(s) known to consume the compound ==
-* [[MANNKIN-RXN-CPD-12601/ATP//MANNOSE-6P/ADP/PROTON.37.]]
+* [[1.3.99.23-RXN]]
+* [[RETINOL-DEHYDROGENASE-RXN]]
+* [[RETINOL-O-FATTY-ACYLTRANSFERASE-RXN]]
+* [[RXN-10841]]
+* [[RXN-12547]]
 == Reaction(s) known to produce the compound ==
+* [[3.1.1.64-RXN]]
+* [[RETINOL-DEHYDROGENASE-RXN]]
+* [[RETINOL-O-FATTY-ACYLTRANSFERASE-RXN]]
+* [[RXN-10841]]
+* [[RXN-12575]]
+* [[RXN-12579]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=&beta;-d-mannopyranose}}
+{{#set: common-name=all-trans-retinol}}
-{{#set: inchi-key=inchikey=wqzgkkkjijffok-rwopyejcsa-n}}
+{{#set: inchi-key=inchikey=fpipgxgpppqfeq-ovsjkpmpsa-n}}
-{{#set: molecular-weight=180.157}}
+{{#set: molecular-weight=286.456}}