Difference between revisions of "CPD-7158"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ00694 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * NAD+-ADP-RIBOSYLTRANSFER...") |
(Created page with "Category:metabolite == Metabolite CPD-7158 == * common-name: ** 3-demethylubiquinol-9 * smiles: ** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cc...") |
||
| (9 intermediate revisions by 5 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-7158 == |
| − | == | + | * common-name: |
| − | * | + | ** 3-demethylubiquinol-9 |
| − | == Reaction(s) | + | * smiles: |
| − | * [[ | + | ** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(=c(c)c(o)=c(o)c(oc)=c(o)1) |
| − | + | * inchi-key: | |
| − | + | ** alajatogwwbpqt-nscwjznlsa-n | |
| − | {{#set: | + | * molecular-weight: |
| − | {{#set: | + | ** 783.228 |
| + | == Reaction(s) known to consume the compound == | ||
| + | * [[2.1.1.64-RXN]] | ||
| + | == Reaction(s) known to produce the compound == | ||
| + | == Reaction(s) of unknown directionality == | ||
| + | {{#set: common-name=3-demethylubiquinol-9}} | ||
| + | {{#set: inchi-key=inchikey=alajatogwwbpqt-nscwjznlsa-n}} | ||
| + | {{#set: molecular-weight=783.228}} | ||
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite CPD-7158
- common-name:
- 3-demethylubiquinol-9
- smiles:
- cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(=c(c)c(o)=c(o)c(oc)=c(o)1)
- inchi-key:
- alajatogwwbpqt-nscwjznlsa-n
- molecular-weight:
- 783.228
