Difference between revisions of "CPD-7206"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ17854 == * transcription-direction: ** negative * right-end-position: ** 478115 * left-end-position: ** 471972 * centisome-position: ** 70.88029...")
(Created page with "Category:metabolite == Metabolite FADH2 == * common-name: ** fadh2 * smiles: ** cc1(=c(c)c=c2(n(c3(nc(nc(=o)c(nc(=c1)2)=3)=o))cc(o)c(o)c(o)cop(op([o-])(occ6(c(o)c(o)c(n5(c...")
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ17854 ==
+
== Metabolite FADH2 ==
−
* transcription-direction:
+
* common-name:
−
** negative
+
** fadh2
−
* right-end-position:
+
* smiles:
−
** 478115
+
** cc1(=c(c)c=c2(n(c3(nc(nc(=o)c(nc(=c1)2)=3)=o))cc(o)c(o)c(o)cop(op([o-])(occ6(c(o)c(o)c(n5(c=nc4(c(n)=nc=nc=45)))o6))=o)([o-])=o))
−
* left-end-position:
+
* inchi-key:
−
** 471972
+
** ypzrhbjkemoyqh-uybvjogssa-l
−
* centisome-position:
+
* molecular-weight:
−
** 70.88029   
+
** 785.556
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[ACOAD1f]]
−
== Reaction(s) associated ==
+
* [[PPCOAOm]]
−
* [[PEPTIDYLPROLYL-ISOMERASE-RXN]]
+
* [[RXN-14264]]
−
** Category: [[annotation]]
+
== Reaction(s) known to produce the compound ==
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[ACOA120OR]]
−
** Category: [[orthology]]
+
* [[ACOA140OR]]
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
* [[ACOA160OR]]
−
{{#set: transcription-direction=negative}}
+
* [[ACOA40OR]]
−
{{#set: right-end-position=478115}}
+
* [[ACOA80OR]]
−
{{#set: left-end-position=471972}}
+
* [[ACOAD1f]]
−
{{#set: centisome-position=70.88029    }}
+
* [[IVCDH]]
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
+
* [[MCDH]]
−
{{#set: nb reaction associated=1}}
+
* [[MCDH_LPAREN_2mb2coa_RPAREN_]]
 +
* [[PPCOAOm]]
 +
* [[RXN-14264]]
 +
* [[SUCDHm]]
 +
== Reaction(s) of unknown directionality ==
 +
{{#set: common-name=fadh2}}
 +
{{#set: inchi-key=inchikey=ypzrhbjkemoyqh-uybvjogssa-l}}
 +
{{#set: molecular-weight=785.556}}

Revision as of 20:31, 18 December 2020

Metabolite FADH2

  • common-name:
    • fadh2
  • smiles:
    • cc1(=c(c)c=c2(n(c3(nc(nc(=o)c(nc(=c1)2)=3)=o))cc(o)c(o)c(o)cop(op([o-])(occ6(c(o)c(o)c(n5(c=nc4(c(n)=nc=nc=45)))o6))=o)([o-])=o))
  • inchi-key:
    • ypzrhbjkemoyqh-uybvjogssa-l
  • molecular-weight:
    • 785.556

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-7206&oldid=45866"